Feedback

 

Myxochlin B

Image of MNXM62863
Properties
MNX_IDMNXM62863
formulaC20H28N3O6
charge1
mass406.4523
referenceseed:cpd03868
InChIKeyHQEULXXQFICACJ-UHFFFAOYSA-O
InChIInChI=1S/C20H27N3O6/c21-11-12(23-20(29)14-7-4-9-16(25)18(14)27)5-1-2-10-22-19(28)13-6-3-8-15(24)17(13)26/h3-4,6-9,12,20,23-27,29H,1-2,5,10-11,21H2,(H,22,28)/p+1
SMILES[NH3+]CC(CCCCNC(=O)c1cccc(O)c1O)NC(O)c1cccc(O)c1O

This chemical compound does not exist in my selection



Occurrences of Myxochlin B in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
seed:cpd03868 Myxochlin B