Feedback

 

N'-(2-hydroxybenzoyl)-2,6-dimethoxybenzohydrazide

Image of MNXM62874
Properties
MNX_IDMNXM62874
formulaC16H16N2O5
charge0
mass316.3086
referencechebi:52611
InChIKeyNHBHUPPOSSJZSN-UHFFFAOYSA-N
InChIInChI=1S/C16H16N2O5/c1-22-12-8-5-9-13(23-2)14(12)16(21)18-17-15(20)10-6-3-4-7-11(10)19/h3-9,19H,1-2H3,(H,17,20)(H,18,21)
SMILESCOc1cccc(OC)c1C(=O)NNC(=O)c1ccccc1O

This chemical compound does not exist in my selection



Occurrences of N'-(2-hydroxybenzoyl)-2,6-dimethoxybenzohydrazide in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
chebi:52611 2,6-dimethoxybenzoylsalicylhydrazidate
2,6-dimethoxybenzoylsalicylhydrazide
2,6-dimethoxybenzoylsalicylhydrazine
N'-(2-hydroxybenzoyl)-2,6-dimethoxybenzohydrazide
NHBHUPPOSSJZSN-UHFFFAOYSA-N