Feedback

 

N-(2,4-dinitrophenyl)aminohexanoic acid

Image of MNXM63132
Properties
MNX_IDMNXM63132
formulaC12H14N3O6
charge-1
mass296.2566
referencechebi:53698
InChIKeyZYUWUKIAUDIXCQ-UHFFFAOYSA-M
InChIInChI=1S/C12H15N3O6/c16-12(17)4-2-1-3-7-13-10-6-5-9(14(18)19)8-11(10)15(20)21/h5-6,8,13H,1-4,7H2,(H,16,17)/p-1
SMILES[O-]C(=O)CCCCCNc1ccc(cc1[N+]([O-])=O)[N+]([O-])=O

This chemical compound does not exist in my selection



Occurrences of N-(2,4-dinitrophenyl)aminohexanoic acid in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
chebi:53698 2,4-dinitrophenyl-epsilon-aminocaproic acid
6-(2,4-Dinitroanilino)hexansaeure
6-N-(2,4-Dinitrophenyl)aminohexanoic acid
6-[(2,4-dinitrophenyl)amino]hexanoic acid
DNP caproic acid
DNP-Cap
Dnp-aminocaproic acid
Dnp-epsilon-aminocaproate
N-(2,4-dinitrophenyl)aminohexanoic acid
ZYUWUKIAUDIXCQ-UHFFFAOYSA-N