Feedback

 

N-(3-{[(N-{2-[(beta-Ala-Leu-Ala)NH]ethyl}-Trp)amino]methyl}benzoyl)-Leu-Thr-Val

Image of MNXM63194
Properties
MNX_IDMNXM63194
formulaC48H73N10O10
charge1
mass950.1537
referencechebi:63871
InChIKeyUXPAANVOZHSFOS-IUSUHJFCSA-O
InChIInChI=1S/C48H72N10O10/c1-26(2)20-37(55-39(60)16-17-49)45(64)54-29(7)42(61)51-19-18-50-36(23-33-25-52-35-15-10-9-14-34(33)35)44(63)53-24-31-12-11-13-32(22-31)43(62)56-38(21-27(3)4)46(65)58-41(30(8)59)47(66)57-40(28(5)6)48(67)68/h9-15,22,25-30,36-38,40-41,50,52,59H,16-21,23-24,49H2,1-8H3,(H,51,61)(H,53,63)(H,54,64)(H,55,60)(H,56,62)(H,57,66)(H,58,65)(H,67,68)/p+1/t29-,30+,36-,37-,38-,40-,41-/m0/s1
SMILESCC(C)C[C@H](NC(=O)CC[NH3+])C(=O)N[C@@H](C)C(=O)NCC[NH2+][C@@H](Cc1c[nH]c2ccccc12)C(=O)NCc1cccc(c1)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H]([C@@H](C)O)C(=O)N[C@@H](C(C)C)C([O-])=O

This chemical compound does not exist in my selection



Occurrences of N-(3-{[(N-{2-[(beta-Ala-Leu-Ala)NH]ethyl}-Trp)amino]methyl}benzoyl)-Leu-Thr-Val in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
chebi:63871 N-(3-{[(N-{2-[(beta-Ala-Leu-Ala)NH]ethyl}-Trp)amino]methyl}benzoyl)-Leu-Thr-Val
N-(3-{[(N-{2-[(beta-alanyl-L-leucyl-L-alanyl)amino]ethyl}-L-tryptophyl)amino]methyl}benzoyl)-L-leucyl-L-threonyl-L-valine
N-(3-{[(N-{2-[(beta-alanylleucylalanyl)amino]ethyl}tryptophyl)amino]methyl}benzoyl)leucylthreonylvaline
UXPAANVOZHSFOS-IUSUHJFCSA-N
betaALAG(PsiCH2NH)W-(3-aminomethylbenzoic acid)-LTV