Feedback

 

N-(3-furoyl)-D-valyl-L-valyl-N-((1R,2Z)-4-ethoxy-4-oxo-1-{[(3S)-2-oxopyrrolidin-3-yl]methyl}but-2-enyl)-D-leucinamide

Image of MNXM63199
Properties
MNX_IDMNXM63199
formulaC32H49N5O8
charge0
mass631.7602
referencechebi:40384
InChIKeyJQGYBVLTABWBOF-VTQXMFKGSA-N
InChIInChI=1S/C32H49N5O8/c1-8-45-25(38)10-9-23(16-21-11-13-33-28(21)39)34-30(41)24(15-18(2)3)35-31(42)26(19(4)5)37-32(43)27(20(6)7)36-29(40)22-12-14-44-17-22/h9-10,12,14,17-21,23-24,26-27H,8,11,13,15-16H2,1-7H3,(H,33,39)(H,34,41)(H,35,42)(H,36,40)(H,37,43)/b10-9+/t21-,23+,24-,26-,27-/m0/s1
SMILES[H]\C(=C(\[H])[C@]([H])(C[C@]1([H])CC[NH+]=C1[O-])[NH+]=C([O-])[C@]([H])(CC(C)C)[NH+]=C([O-])[C@@]([H])([NH+]=C([O-])[C@@]([H])([NH+]=C([O-])c1ccoc1)C(C)C)C(C)C)C(=O)OCC

This chemical compound does not exist in my selection



Occurrences of N-(3-furoyl)-D-valyl-L-valyl-N-((1R,2Z)-4-ethoxy-4-oxo-1-{[(3S)-2-oxopyrrolidin-3-yl]methyl}but-2-enyl)-D-leucinamide in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
chebi:40384 JQGYBVLTABWBOF-VTQXMFKGSA-N
N-(3-FUROYL)-D-VALYL-L-VALYL-N~1~-((1R,2Z)-4-ETHOXY-4-OXO-1-{[(3S)-2-OXOPYRROLIDIN-3-YL]METHYL}BUT-2-ENYL)-D-LEUCINAMIDE
N-(3-furoyl)-D-valyl-L-valyl-N-((1R,2Z)-4-ethoxy-4-oxo-1-{[(3S)-2-oxopyrrolidin-3-yl]methyl}but-2-enyl)-D-leucinamide
N-(furan-3-ylcarbonyl)-L-valyl-L-valyl-N-[(1S,2E)-4-ethoxy-4-oxo-1-{[(3S)-2-oxopyrrolidin-3-yl]methyl}but-2-en-1-yl]-L-leucinamide