Feedback

 

N-(6-Oxo-6H-dibenzo[b,d]pyran-3-yl)maleamic acid

Image of MNXM63221
Properties
MNX_IDMNXM63221
formulaC17H10NO5
charge-1
mass308.2655
referencechebi:79963
InChIKeyHHGLRTMNBJCNJN-FPLPWBNLSA-M
InChIInChI=1S/C17H11NO5/c19-15(7-8-16(20)21)18-10-5-6-12-11-3-1-2-4-13(11)17(22)23-14(12)9-10/h1-9H,(H,18,19)(H,20,21)/p-1/b8-7-
SMILES[O-]C(=O)\C=C/C(=O)Nc1ccc2c(c1)oc(=O)c1ccccc21

This chemical compound does not exist in my selection



Occurrences of N-(6-Oxo-6H-dibenzo[b,d]pyran-3-yl)maleamic acid in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
chebi:79963 HHGLRTMNBJCNJN-FPLPWBNLSA-N
N-(6-Oxo-6H-dibenzo[b,d]pyran-3-yl)maleamic acid
kegg:C15466
seed:cpd11156
N-(6-Oxo-6H-dibenzo[b,d]pyran-3-yl)maleamic acid
deprecated:MNXM95354