Feedback

 

N-({4-[(1S)-4-(2,4-diamino-6-hydroxypyrimidin-5-yl)-1-(2,2,2-trifluoro-1,1-dihydroxyethyl)butyl]phenyl}carbonyl)-L-gamma-glutamyl-gamma-glutamyl-gamma-glutamyl-gamma-glutamylglutamic acid

Image of MNXM63229
Properties
MNX_IDMNXM63229
formulaC42H48F3N9O20
charge-6
mass1055.8773
referencechebi:43671
InChIKeyIWEGOVKIJZGOSL-QHSXUUMZSA-H
InChIInChI=1S/C42H54F3N9O20/c43-42(44,45)41(73,74)21(3-1-2-20-32(46)53-40(47)54-34(20)62)18-4-6-19(7-5-18)33(61)52-26(39(71)72)11-16-30(58)50-24(37(67)68)9-14-28(56)48-22(35(63)64)8-13-27(55)49-23(36(65)66)10-15-29(57)51-25(38(69)70)12-17-31(59)60/h4-7,21-26,73-74H,1-3,8-17H2,(H,48,56)(H,49,55)(H,50,58)(H,51,57)(H,52,61)(H,59,60)(H,63,64)(H,65,66)(H,67,68)(H,69,70)(H,71,72)(H5,46,47,53,54,62)/p-6/t21-,22+,23+,24+,25+,26-/m0/s1
SMILES[H][C@@](CCC([O-])=[NH+][C@]([H])(CCC([O-])=[NH+][C@]([H])(CCC([O-])=[NH+][C@]([H])(CCC([O-])=[NH+][C@]([H])(CCC([O-])=O)C([O-])=O)C([O-])=O)C([O-])=O)C([O-])=O)(NC(=O)c1ccc(cc1)[C@]([H])(CCCc1c(N)[nH]c(=[NH2+])nc1[O-])C(O)(O)C(F)(F)F)C([O-])=O

This chemical compound does not exist in my selection



Occurrences of N-({4-[(1S)-4-(2,4-diamino-6-hydroxypyrimidin-5-yl)-1-(2,2,2-trifluoro-1,1-dihydroxyethyl)butyl]phenyl}carbonyl)-L-gamma-glutamyl-gamma-glutamyl-gamma-glutamyl-gamma-glutamylglutamic acid in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
chebi:43671 IWEGOVKIJZGOSL-QHSXUUMZSA-N
N-({4-[(1S)-4-(2,4-diamino-6-hydroxypyrimidin-5-yl)-1-(2,2,2-trifluoro-1,1-dihydroxyethyl)butyl]phenyl}carbonyl)-L-gamma-glutamyl-gamma-glutamyl-gamma-glutamyl-gamma-glutamylglutamic acid
N-{4-4-(2,4-DIAMINO-6-OXO-1,6-DIHYDRO-PYRIMIDIN-5-YL)-1-(2,2,2-TRIFLUORO-1,1-DIHYDROXY-ETHYL)-BUT-2-YL-BENZOYL}-GAMMA-GLUTAMYL-GAMMA-GLUTAMYL-GAMMA-GLUTAMYL-GAMMA-GLUTAMYL-GLUTAMIC ACID