Feedback

 

N-({4-[(1S)-4-(2,4-diamino-6-hydroxypyrimidin-5-yl)-1-(2,2,2-trifluoro-1,1-dihydroxyethyl)butyl]phenyl}carbonyl)-L-gamma-glutamyl-gamma-glutamylglutamic acid

Image of MNXM63230
Properties
MNX_IDMNXM63230
formulaC32H37F3N7O14
charge-3
mass800.6715
referencechebi:43532
InChIKeyDJAOVLPLLJHHPY-NMLBUPMWSA-K
InChIInChI=1S/C32H40F3N7O14/c33-32(34,35)31(55,56)17(3-1-2-16-24(36)41-30(37)42-26(16)48)14-4-6-15(7-5-14)25(47)40-20(29(53)54)9-12-22(44)38-18(27(49)50)8-11-21(43)39-19(28(51)52)10-13-23(45)46/h4-7,17-20,55-56H,1-3,8-13H2,(H,38,44)(H,39,43)(H,40,47)(H,45,46)(H,49,50)(H,51,52)(H,53,54)(H5,36,37,41,42,48)/p-3/t17-,18+,19+,20-/m0/s1
SMILES[H][C@@](CCC([O-])=[NH+][C@]([H])(CCC([O-])=[NH+][C@]([H])(CCC([O-])=O)C([O-])=O)C([O-])=O)(NC(=O)c1ccc(cc1)[C@]([H])(CCCc1c(N)[nH]c(=[NH2+])[nH+]c1[O-])C(O)(O)C(F)(F)F)C([O-])=O

This chemical compound does not exist in my selection



Occurrences of N-({4-[(1S)-4-(2,4-diamino-6-hydroxypyrimidin-5-yl)-1-(2,2,2-trifluoro-1,1-dihydroxyethyl)butyl]phenyl}carbonyl)-L-gamma-glutamyl-gamma-glutamylglutamic acid in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
chebi:43532 DJAOVLPLLJHHPY-NMLBUPMWSA-N
N-({4-[(1S)-4-(2,4-diamino-6-hydroxypyrimidin-5-yl)-1-(2,2,2-trifluoro-1,1-dihydroxyethyl)butyl]phenyl}carbonyl)-L-gamma-glutamyl-gamma-glutamylglutamic acid
N-{4-4-(2,4-DIAMINO-6-OXO-1,6-DIHYDRO-PYRIMIDIN-5-YL)-1-(2,2,2-TRIFLUORO-1,1-DIHYDROXY-ETHYL)-BUT-2-YL-BENZOYL}-GAMMA-GLUTAMYL-GAMMA-GLUTAMYL-GLUTAMIC ACID