Feedback

 

N-({4-[2-(2-amino-4-oxo-4,7-dihydro-3H-pyrrolo[2,3-d]pyrimidin-5-yl)ethyl]phenyl}carbonyl)-L-gamma-glutamyl-L-gamma-glutamyl-L-gamma-glutamylglutamic acid

Image of MNXM63233
Properties
MNX_IDMNXM63233
formulaC35H38N8O15
charge-4
mass810.723
referencechebi:43865
InChIKeyDICHBVJYDUDAIQ-KJJMTIBFSA-J
InChIInChI=1S/C35H42N8O15/c36-35-42-28-27(30(50)43-35)18(15-37-28)6-3-16-1-4-17(5-2-16)29(49)41-22(34(57)58)9-13-25(46)39-20(32(53)54)7-11-23(44)38-19(31(51)52)8-12-24(45)40-21(33(55)56)10-14-26(47)48/h1-2,4-5,15,19-22H,3,6-14H2,(H,38,44)(H,39,46)(H,40,45)(H,41,49)(H,47,48)(H,51,52)(H,53,54)(H,55,56)(H,57,58)(H4,36,37,42,43,50)/p-4/t19-,20-,21+,22-/m0/s1
SMILES[H][C@@](CCC([O-])=[NH+][C@@]([H])(CCC([O-])=[NH+][C@@]([H])(CCC([O-])=[NH+][C@]([H])(CCC([O-])=O)C([O-])=O)C([O-])=O)C([O-])=O)(NC(=O)c1ccc(CCc2c[nH]c3[nH]c(=[NH2+])nc(O)c23)cc1)C([O-])=O

This chemical compound does not exist in my selection



Occurrences of N-({4-[2-(2-amino-4-oxo-4,7-dihydro-3H-pyrrolo[2,3-d]pyrimidin-5-yl)ethyl]phenyl}carbonyl)-L-gamma-glutamyl-L-gamma-glutamyl-L-gamma-glutamylglutamic acid in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
chebi:43865 2-{4-[4-(4-{4-[2-(2-AMINO-4-OXO-4,7-DIHYDRO-3H-PYRROLO[2,3-D]PYRIMIDIN-5-YL)-ETHYL]-BENZOYLAMINO}-4-CARBOXY-BUTYRYLAMINO)-4-CARBOXY-BUTYRYLAMINO}-PENTANEDIOIC ACID
DICHBVJYDUDAIQ-KJJMTIBFSA-N
N-({4-[2-(2-amino-4-oxo-4,7-dihydro-3H-pyrrolo[2,3-d]pyrimidin-5-yl)ethyl]phenyl}carbonyl)-L-gamma-glutamyl-L-gamma-glutamyl-L-gamma-glutamylglutamic acid