Feedback

 

N-(phosphonomethyl)iminodiacetic acid

Image of MNXM63259
Properties
MNX_IDMNXM63259
formulaC5H7NO7P
charge-3
mass224.087
referencechebi:63485
InChIKeyAZIHIQIVLANVKD-UHFFFAOYSA-K
InChIInChI=1S/C5H10NO7P/c7-4(8)1-6(2-5(9)10)3-14(11,12)13/h1-3H2,(H,7,8)(H,9,10)(H2,11,12,13)/p-3
SMILES[O-]C(=O)C[NH+](CC([O-])=O)CP([O-])([O-])=O

This chemical compound does not exist in my selection



Occurrences of N-(phosphonomethyl)iminodiacetic acid in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
chebi:63485 2,2'-[(phosphonomethyl)imino]diacetic acid
AZIHIQIVLANVKD-UHFFFAOYSA-N
N-(Carboxymethyl)-N-(phosphonomethyl)glycine
N-(phosphonomethyl)iminodiacetic acid
Phosphonomethyliminodiacetic acid