Feedback

 

N-(trans-4'-nitro-4-stilbenyl)-N-methyl-5-aminopentanoic acid

Image of MNXM63266
Properties
MNX_IDMNXM63266
formulaC20H21N2O4
charge-1
mass353.3923
referencechebi:46151
InChIKeyQLLZAVDYYAQESE-AATRIKPKSA-M
InChIInChI=1S/C20H22N2O4/c1-21(15-3-2-4-20(23)24)18-11-7-16(8-12-18)5-6-17-9-13-19(14-10-17)22(25)26/h5-14H,2-4,15H2,1H3,(H,23,24)/p-1/b6-5+
SMILESCN(CCCCC([O-])=O)c1ccc(\C=C\c2ccc(cc2)[N+]([O-])=O)cc1

This chemical compound does not exist in my selection



Occurrences of N-(trans-4'-nitro-4-stilbenyl)-N-methyl-5-aminopentanoic acid in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
chebi:46151 5-(methyl{4-[(E)-2-(4-nitrophenyl)ethenyl]phenyl}amino)pentanoic acid
5-(methyl{4-[(E)-2-(4-nitrophenyl)vinyl]phenyl}amino)pentanoic acid
N-(trans-4'-nitro-4-stilbenyl)-N-methyl-5-aminopentanoic acid
QLLZAVDYYAQESE-AATRIKPKSA-N