Feedback

 

N-(trans-4-{(1S,2S)-2-amino-3-[(3S)-3-fluoropyrrolidin-1-yl]-1-methyl-3-oxopropyl}cyclohexyl)-N-methylacetamide

Image of MNXM63267
Properties
MNX_IDMNXM63267
formulaC17H31FN3O2
charge1
mass328.4448
referencechebi:39772
InChIKeyBZFQBRSDORUYAB-YDMUCJKGSA-O
InChIInChI=1S/C17H30FN3O2/c1-11(16(19)17(23)21-9-8-14(18)10-21)13-4-6-15(7-5-13)20(3)12(2)22/h11,13-16H,4-10,19H2,1-3H3/p+1/t11-,13-,14-,15-,16-/m0/s1
SMILES[H][C@@]([NH3+])(C(=O)N1CC[C@]([H])(F)C1)[C@@]([H])(C)[C@@]1([H])CC[C@@]([H])(CC1)N(C)C(C)=O

This chemical compound does not exist in my selection



Occurrences of N-(trans-4-{(1S,2S)-2-amino-3-[(3S)-3-fluoropyrrolidin-1-yl]-1-methyl-3-oxopropyl}cyclohexyl)-N-methylacetamide in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
chebi:39772 BZFQBRSDORUYAB-YDMUCJKGSA-N
N-(TRANS-4-{(1S,2S)-2-AMINO-3-[(3S)-3-FLUOROPYRROLIDIN-1-YL]-1-METHYL-3-OXOPROPYL}CYCLOHEXYL)-N-METHYLACETAMIDE
N-(trans-4-{(1S,2S)-2-amino-3-[(3S)-3-fluoropyrrolidin-1-yl]-1-methyl-3-oxopropyl}cyclohexyl)-N-methylacetamide