Feedback

 

N-[(1R)-1-[({[(5S)-3,5-dimethyl-2,5-dihydroisoxazol-4-yl]methyl}sulfonyl)methyl]-2-oxo-2-({(1S)-3-phenyl-1-[2-(phenylsulfonyl)ethyl]propyl}amino)ethyl]morpholine-4-carboxamide

Image of MNXM63271
Properties
MNX_IDMNXM63271
formulaC31H42N4O8S2
charge0
mass662.817
referencechebi:41056
InChIKeyKPLOSZKQTFPNFM-MIUCGUHXSA-N
InChIInChI=1S/C31H42N4O8S2/c1-23-28(24(2)43-34-23)21-44(38,39)22-29(33-31(37)35-16-18-42-19-17-35)30(36)32-26(14-13-25-9-5-3-6-10-25)15-20-45(40,41)27-11-7-4-8-12-27/h3-12,24,26,29,34H,13-22H2,1-2H3,(H,32,36)(H,33,37)/t24-,26-,29-/m0/s1
SMILES[H][C@](CCc1ccccc1)(CCS(=O)(=O)c1ccccc1)[NH+]=C([O-])[C@]([H])(CS(=O)(=O)CC1=C(C)NO[C@@]1([H])C)[NH+]=C([O-])N1CCOCC1

This chemical compound does not exist in my selection



Occurrences of N-[(1R)-1-[({[(5S)-3,5-dimethyl-2,5-dihydroisoxazol-4-yl]methyl}sulfonyl)methyl]-2-oxo-2-({(1S)-3-phenyl-1-[2-(phenylsulfonyl)ethyl]propyl}amino)ethyl]morpholine-4-carboxamide in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
chebi:41056 KPLOSZKQTFPNFM-MIUCGUHXSA-N
N-[(1R)-1-[({[(5S)-3,5-DIMETHYL-2,5-DIHYDROISOXAZOL-4-YL]METHYL}SULFONYL)METHYL]-2-OXO-2-({(1S)-3-PHENYL-1-[2-(PHENYLSULFONYL)ETHYL]PROPYL}AMINO)ETHYL]MORPHOLINE-4-CARBOXAMIDE
N-[(1R)-1-[({[(5S)-3,5-dimethyl-2,5-dihydroisoxazol-4-yl]methyl}sulfonyl)methyl]-2-oxo-2-({(1S)-3-phenyl-1-[2-(phenylsulfonyl)ethyl]propyl}amino)ethyl]morpholine-4-carboxamide