Feedback

 

N-[(1R)-2-{(2S)-2-[(3-carbamimidamidopropyl)carbamoyl]piperidin-1-yl}-1-(cyclohexylmethyl)-2-oxoethyl]glycine

Image of MNXM63274
Properties
MNX_IDMNXM63274
formulaC21H39N6O4
charge1
mass439.5716
referencechebi:43313
InChIKeyCDPROXZBMHOBTQ-SJORKVTESA-O
InChIInChI=1S/C21H38N6O4/c22-21(23)25-11-6-10-24-19(30)17-9-4-5-12-27(17)20(31)16(26-14-18(28)29)13-15-7-2-1-3-8-15/h15-17,26H,1-14H2,(H,24,30)(H,28,29)(H4,22,23,25)/p+1/t16-,17+/m1/s1
SMILES[H][C@](CC1CCCCC1)([NH2+]CC([O-])=O)C(=O)N1CCCC[C@@]1([H])C([O-])=[NH+]CCCNC(N)=[NH2+]

This chemical compound does not exist in my selection



Occurrences of N-[(1R)-2-{(2S)-2-[(3-carbamimidamidopropyl)carbamoyl]piperidin-1-yl}-1-(cyclohexylmethyl)-2-oxoethyl]glycine in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
chebi:43313 CDPROXZBMHOBTQ-SJORKVTESA-N
N-[(1R)-2-{(2S)-2-[(3-carbamimidamidopropyl)carbamoyl]piperidin-1-yl}-1-(cyclohexylmethyl)-2-oxoethyl]glycine
{[(1R)-2-((2S)-2-{[(3-{[AMINO(IMINO)METHYL]AMINO}PROPYL)AMINO]CARBONYL}PIPERIDINYL)-1-(CYCLOHEXYLMETHYL)-2-OXOETHYL]AMINO}ACETIC ACID