Feedback

 

N-[(1S)-3-methyl-1-({(4S)-3-oxo-1-[(3-pyridin-2-ylphenyl)acetyl]azepan-4-yl}carbamoyl)butyl]-5-(2-morpholin-4-ylethoxy)-1-benzofuran-2-carboxamide

Image of MNXM63284
Properties
MNX_IDMNXM63284
formulaC40H47N5O7
charge0
mass709.8305
referencechebi:40306
InChIKeyKRMYDWCAHQJBOD-HEVIKAOCSA-N
InChIInChI=1S/C40H47N5O7/c1-27(2)21-34(43-40(49)37-25-30-24-31(11-12-36(30)52-37)51-20-17-44-15-18-50-19-16-44)39(48)42-33-10-6-14-45(26-35(33)46)38(47)23-28-7-5-8-29(22-28)32-9-3-4-13-41-32/h3-5,7-9,11-13,22,24-25,27,33-34H,6,10,14-21,23,26H2,1-2H3,(H,42,48)(H,43,49)/t33-,34-/m0/s1
SMILES[H][C@@](CC(C)C)([NH+]=C([O-])c1cc2cc(OCCN3CCOCC3)ccc2o1)C([O-])=[NH+][C@@]1([H])CCCN(CC1=O)C(=O)Cc1cccc(c1)-c1ccccn1

This chemical compound does not exist in my selection



Occurrences of N-[(1S)-3-methyl-1-({(4S)-3-oxo-1-[(3-pyridin-2-ylphenyl)acetyl]azepan-4-yl}carbamoyl)butyl]-5-(2-morpholin-4-ylethoxy)-1-benzofuran-2-carboxamide in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
chebi:40306 5-(2-MORPHOLIN-4-YLETHOXY)BENZOFURAN-2-CARBOXYLIC ACID ((S)-3-METHYL-1-{(S)-3-OXO-1-[2-(3-PYRIDIN-2-YLPHENYL)ACETYL]AZEPAN-4-YLCARBAMOYL}BUTYL)AMIDE
KRMYDWCAHQJBOD-HEVIKAOCSA-N
N-[(1S)-3-methyl-1-({(4S)-3-oxo-1-[(3-pyridin-2-ylphenyl)acetyl]azepan-4-yl}carbamoyl)butyl]-5-(2-morpholin-4-ylethoxy)-1-benzofuran-2-carboxamide