Feedback

 

N-[(2R,3S)-1-((2S)-2-{[(cyclopentylamino)carbonyl]amino}-3-methylbutanoyl)-2-(1-formylcyclobutan-1-yl)pyrrolidin-3-yl]cyclopropanecarboxamide

Image of MNXM63290
Properties
MNX_IDMNXM63290
formulaC24H38N4O4
charge0
mass446.5829
referencechebi:41590
InChIKeyGCDRFILPPBOJLM-UFYCRDLUSA-N
InChIInChI=1S/C24H38N4O4/c1-15(2)19(27-23(32)25-17-6-3-4-7-17)22(31)28-13-10-18(26-21(30)16-8-9-16)20(28)24(14-29)11-5-12-24/h14-20H,3-13H2,1-2H3,(H,26,30)(H2,25,27,32)/t18-,19-,20-/m0/s1
SMILES[H][C@](NC([O-])=[NH+]C1CCCC1)(C(C)C)C(=O)N1CC[C@]([H])([NH+]=C([O-])C2CC2)[C@@]1([H])C1(CCC1)C=O

This chemical compound does not exist in my selection



Occurrences of N-[(2R,3S)-1-((2S)-2-{[(cyclopentylamino)carbonyl]amino}-3-methylbutanoyl)-2-(1-formylcyclobutan-1-yl)pyrrolidin-3-yl]cyclopropanecarboxamide in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
chebi:41590 GCDRFILPPBOJLM-UFYCRDLUSA-N
N-[(2R,3S)-1-((2S)-2-{[(CYCLOPENTYLAMINO)CARBONYL]AMINO}-3-METHYLBUTANOYL)-2-(1-FORMYL-1-CYCLOBUTYL)PYRROLIDINYL]CYCLOPROPANECARBOXAMIDE
N-[(2R,3S)-1-((2S)-2-{[(cyclopentylamino)carbonyl]amino}-3-methylbutanoyl)-2-(1-formylcyclobutan-1-yl)pyrrolidin-3-yl]cyclopropanecarboxamide
N-[(2R,3S)-1-[N-(cyclopentylcarbamoyl)-L-valyl]-2-(1-formylcyclobutyl)pyrrolidin-3-yl]cyclopropanecarboxamide