Feedback

 

N-[(2S)-2-[(4S)-2-amino-1,4,5,6-tetrahydropyrimidin-4-yl]-2-({[(1S)-1-carboxy-2-phenylethyl]carbamoyl}amino)acetyl]-L-leucyl-L-phenylalanine

Image of MNXM63291
Properties
MNX_IDMNXM63291
formulaC31H40N7O7
charge-1
mass622.6925
referencechebi:41654
InChIKeyMNHUFUWSOBLOCE-KEOOTSPTSA-M
InChIInChI=1S/C31H41N7O7/c1-18(2)15-22(26(39)35-23(28(41)42)16-19-9-5-3-6-10-19)34-27(40)25(21-13-14-33-30(32)36-21)38-31(45)37-24(29(43)44)17-20-11-7-4-8-12-20/h3-12,18,21-25H,13-17H2,1-2H3,(H,34,40)(H,35,39)(H,41,42)(H,43,44)(H3,32,33,36)(H2,37,38,45)/p-1/t21-,22-,23-,24-,25-/m0/s1
SMILES[H][C@@](Cc1ccccc1)([NH+]=C([O-])N[C@]([H])(C([O-])=[NH+][C@@]([H])(CC(C)C)C([O-])=[NH+][C@@]([H])(Cc1ccccc1)C([O-])=O)[C@]1([H])CCNC(=[NH2+])N1)C([O-])=O

This chemical compound does not exist in my selection



Occurrences of N-[(2S)-2-[(4S)-2-amino-1,4,5,6-tetrahydropyrimidin-4-yl]-2-({[(1S)-1-carboxy-2-phenylethyl]carbamoyl}amino)acetyl]-L-leucyl-L-phenylalanine in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
chebi:41654 MNHUFUWSOBLOCE-KEOOTSPTSA-N
N-[(2S)-2-[(4S)-2-amino-1,4,5,6-tetrahydropyrimidin-4-yl]-2-({[(1S)-1-carboxy-2-phenylethyl]carbamoyl}amino)acetyl]-L-leucyl-L-phenylalanine
[[PHENYLALANINE-CARBONYL-AMINO-2-(2-AMINO-1,4,5,6-TETRAHYDRO-PYRIMIDIN-4-YL)-1-ACETALDEHYDYL]-2-ISOBUTYL-GLYCYL]PHENYLALANINE