Feedback

 

N-[(3R,4R)-4-{[(4-{[5-(4,4-dimethylpiperidin-1-yl)-2-hydroxyphenyl]carbonyl}phenyl)carbonyl]amino}azepan-3-yl]isonicotinamide

Image of MNXM63304
Properties
MNX_IDMNXM63304
formulaC33H40N5O4
charge1
mass570.7013
referencechebi:45252
InChIKeyYGHLZBJWLNYECG-VSGBNLITSA-O
InChIInChI=1S/C33H39N5O4/c1-33(2)13-18-38(19-14-33)25-9-10-29(39)26(20-25)30(40)22-5-7-23(8-6-22)31(41)36-27-4-3-15-35-21-28(27)37-32(42)24-11-16-34-17-12-24/h5-12,16-17,20,27-28,35,39H,3-4,13-15,18-19,21H2,1-2H3,(H,36,41)(H,37,42)/p+1/t27-,28-/m1/s1
SMILES[H][C@]1(CCC[NH2+]C[C@@]1([H])NC(=O)c1ccncc1)NC(=O)c1ccc(cc1)C(=O)c1cc(ccc1O)N1CCC(C)(C)CC1

This chemical compound does not exist in my selection



Occurrences of N-[(3R,4R)-4-{[(4-{[5-(4,4-dimethylpiperidin-1-yl)-2-hydroxyphenyl]carbonyl}phenyl)carbonyl]amino}azepan-3-yl]isonicotinamide in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
chebi:45252 N-[(3R,4R)-4-{[(4-{[5-(4,4-dimethylpiperidin-1-yl)-2-hydroxyphenyl]carbonyl}phenyl)carbonyl]amino}azepan-3-yl]isonicotinamide
N-[(3R,4R)-4-{[(4-{[5-(4,4-dimethylpiperidin-1-yl)-2-hydroxyphenyl]carbonyl}phenyl)carbonyl]amino}azepan-3-yl]pyridine-4-carboxamide
N-[4-({4-[5-(4,4-DIMETHYLPIPERIDIN-1-YL)-2-HYDROXYBENZOYL]BENZOYL}AMINO)AZEPAN-3-YL]ISONICOTINAMIDE
YGHLZBJWLNYECG-VSGBNLITSA-N