Feedback

 

N-[(4-{[(2,4-diaminofuro[2,3-d]pyrimidin-5-yl)methyl](methyl)amino}phenyl)carbonyl]-L-glutamic acid

Image of MNXM63311
Properties
MNX_IDMNXM63311
formulaC20H21N6O6
charge-1
mass441.4179
referencechebi:44035
InChIKeyWXINNGCGSCFUCR-ZDUSSCGKSA-M
InChIInChI=1S/C20H22N6O6/c1-26(8-11-9-32-18-15(11)16(21)24-20(22)25-18)12-4-2-10(3-5-12)17(29)23-13(19(30)31)6-7-14(27)28/h2-5,9,13H,6-8H2,1H3,(H,23,29)(H,27,28)(H,30,31)(H4,21,22,24,25)/p-1/t13-/m0/s1
SMILES[H][C@@](CCC([O-])=O)(NC(=O)c1ccc(cc1)N(C)Cc1coc2nc(=[NH2+])[nH]c(N)c12)C([O-])=O

This chemical compound does not exist in my selection



Occurrences of N-[(4-{[(2,4-diaminofuro[2,3-d]pyrimidin-5-yl)methyl](methyl)amino}phenyl)carbonyl]-L-glutamic acid in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
chebi:44035 N-[(4-{[(2,4-diaminofuro[2,3-d]pyrimidin-5-yl)methyl](methyl)amino}phenyl)carbonyl]-L-glutamic acid
N-[4-[(2,4-DIAMINOFURO[2,3D]PYRIMIDIN-5-YL)METHYL]METHYLAMINO]-BENZOYL]-L-GLUTAMATE
WXINNGCGSCFUCR-ZDUSSCGKSA-N