Feedback

 

N-[(4-{[(2,5-diamino-6-hydroxypyrimidin-4-yl)carbamoyl]amino}phenyl)carbonyl]-L-glutamic acid

Image of MNXM63312
Properties
MNX_IDMNXM63312
formulaC17H18N7O7
charge-1
mass432.3681
referencechebi:43564
InChIKeyWOAHOFUKPOVXKC-VIFPVBQESA-M
InChIInChI=1S/C17H19N7O7/c18-11-12(22-16(19)24-14(11)28)23-17(31)20-8-3-1-7(2-4-8)13(27)21-9(15(29)30)5-6-10(25)26/h1-4,9H,5-6,18H2,(H8,19,20,21,22,23,24,25,26,27,28,29,30,31)/p-1/t9-/m0/s1
SMILES[H][C@@](CCC([O-])=O)(NC(=O)c1ccc(NC([O-])=[NH+]c2[n-]c(=[NH2+])[nH+]c(O)c2N)cc1)C([O-])=O

This chemical compound does not exist in my selection



Occurrences of N-[(4-{[(2,5-diamino-6-hydroxypyrimidin-4-yl)carbamoyl]amino}phenyl)carbonyl]-L-glutamic acid in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
chebi:43564 N-[(4-{[(2,5-diamino-6-hydroxypyrimidin-4-yl)carbamoyl]amino}phenyl)carbonyl]-L-glutamic acid
SZHRIPFGZWWRKW-VIFPVBQESA-N
[[N'-(2,5-DIAMINO-6-HYDROXY-PYRIMIDIN-4-YL)-UREAYL]-PHEN-4-YL]-CARBONYL-GLUTAMIC ACID