Feedback

 

N-[(5-methylisoxazol-3-yl)carbonyl]-L-alanyl-L-valyl-N(1)-((1S)-4-ethoxy-4-oxo-1-{[(3S)-2-oxopyrrolidin-3-yl]methyl}but-2-enyl)-L-leucinamide

Image of MNXM63321
Properties
MNX_IDMNXM63321
formulaC30H46N6O8
charge0
mass618.7216
referencechebi:43193
InChIKeyLIVSSCDUYUOZEL-GLXPMXKMSA-N
InChIInChI=1S/C30H46N6O8/c1-8-43-24(37)10-9-21(15-20-11-12-31-27(20)39)33-28(40)22(13-16(2)3)34-30(42)25(17(4)5)35-26(38)19(7)32-29(41)23-14-18(6)44-36-23/h9-10,14,16-17,19-22,25H,8,11-13,15H2,1-7H3,(H,31,39)(H,32,41)(H,33,40)(H,34,42)(H,35,38)/b10-9+/t19-,20-,21+,22-,25-/m0/s1
SMILES[H]\C(=C(\[H])[C@]([H])(C[C@]1([H])CC[NH+]=C1[O-])[NH+]=C([O-])[C@]([H])(CC(C)C)[NH+]=C([O-])[C@@]([H])([NH+]=C([O-])[C@]([H])(C)NC(=O)c1cc(C)on1)C(C)C)C(=O)OCC

This chemical compound does not exist in my selection



Occurrences of N-[(5-methylisoxazol-3-yl)carbonyl]-L-alanyl-L-valyl-N(1)-((1S)-4-ethoxy-4-oxo-1-{[(3S)-2-oxopyrrolidin-3-yl]methyl}but-2-enyl)-L-leucinamide in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
chebi:43193 LIVSSCDUYUOZEL-GLXPMXKMSA-N
N-[(5-METHYLISOXAZOL-3-YL)CARBONYL]-L-ALANYL-L-VALYL-N~1~-((1S)-4-ETHOXY-4-OXO-1-{[(3S)-2-OXOPYRROLIDIN-3-YL]METHYL}BUT-2-ENYL)-L-LEUCINAMIDE
N-[(5-methylisoxazol-3-yl)carbonyl]-L-alanyl-L-valyl-N(1)-((1S)-4-ethoxy-4-oxo-1-{[(3S)-2-oxopyrrolidin-3-yl]methyl}but-2-enyl)-L-leucinamide
N-[(5-methylisoxazol-3-yl)carbonyl]-L-alanyl-L-valyl-N-[(1S,2E)-4-ethoxy-4-oxo-1-{[(3S)-2-oxopyrrolidin-3-yl]methyl}but-2-en-1-yl]-L-leucinamide