Feedback

 

N-[1-(3-methylbutyl)piperidin-4-yl]-N-{4-[methyl(pyridin-4-yl)amino]benzyl}-4-pentylbenzamide

Image of MNXM63332
Properties
MNX_IDMNXM63332
formulaC35H50N4O
charge2
mass542.7966
referencechebi:40466
InChIKeyWRFRQUOWNCJODU-UHFFFAOYSA-P
InChIInChI=1S/C35H48N4O/c1-5-6-7-8-29-9-13-31(14-10-29)35(40)39(34-20-25-38(26-21-34)24-19-28(2)3)27-30-11-15-32(16-12-30)37(4)33-17-22-36-23-18-33/h9-18,22-23,28,34H,5-8,19-21,24-27H2,1-4H3/p+2
SMILESCCCCCc1ccc(cc1)C(=O)N(Cc1ccc(cc1)N(C)c1cc[nH+]cc1)C1CC[NH+](CCC(C)C)CC1

This chemical compound does not exist in my selection



Occurrences of N-[1-(3-methylbutyl)piperidin-4-yl]-N-{4-[methyl(pyridin-4-yl)amino]benzyl}-4-pentylbenzamide in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
chebi:40466 N-[1-(3-METHYLBUTYL)PIPERIDIN-4-YL]-N-{4-[METHYL(PYRIDIN-4-YL)AMINO]BENZYL}-4-PENTYLBENZAMIDE
N-[1-(3-methylbutyl)piperidin-4-yl]-N-{4-[methyl(pyridin-4-yl)amino]benzyl}-4-pentylbenzamide
WRFRQUOWNCJODU-UHFFFAOYSA-N