Feedback

 

N-[3-({[N-{2-[(alpha-Glu-Leu-Ala)NH]ethyl}-N-(indol-3-ylacetyl)Gly]amino}methyl)benzoyl]-Leu-Thr-Val

Image of MNXM63348
Properties
MNX_IDMNXM63348
formulaC51H73N10O13
charge-1
mass1034.1851
referencechebi:63869
InChIKeyLAHWIXDTTNLOHD-FBJVAKPVSA-M
InChIInChI=1S/C51H74N10O13/c1-27(2)20-38(58-47(69)36(52)16-17-42(65)66)48(70)56-30(7)45(67)53-18-19-61(41(64)23-34-25-54-37-15-10-9-14-35(34)37)26-40(63)55-24-32-12-11-13-33(22-32)46(68)57-39(21-28(3)4)49(71)60-44(31(8)62)50(72)59-43(29(5)6)51(73)74/h9-15,22,25,27-31,36,38-39,43-44,54,62H,16-21,23-24,26,52H2,1-8H3,(H,53,67)(H,55,63)(H,56,70)(H,57,68)(H,58,69)(H,59,72)(H,60,71)(H,65,66)(H,73,74)/p-1/t30-,31+,36-,38-,39-,43-,44-/m0/s1
SMILESCC(C)C[C@H](NC(=O)[C@@H]([NH3+])CCC([O-])=O)C(=O)N[C@@H](C)C(=O)NCCN(CC(=O)NCc1cccc(c1)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H]([C@@H](C)O)C(=O)N[C@@H](C(C)C)C([O-])=O)C(=O)Cc1c[nH]c2ccccc12

This chemical compound does not exist in my selection



Occurrences of N-[3-({[N-{2-[(alpha-Glu-Leu-Ala)NH]ethyl}-N-(indol-3-ylacetyl)Gly]amino}methyl)benzoyl]-Leu-Thr-Val in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
chebi:63869 ELA-NH-(CH2)2-(COCH2indole)G-(3-aminomethylbenzoic acid)-LTV
LAHWIXDTTNLOHD-FBJVAKPVSA-N
N-[3-({[N-{2-[(L-alpha-glutamyl-L-leucyl-L-alanyl)amino]ethyl}-N-(1H-indol-3-ylacetyl)glycyl]amino}methyl)benzoyl]-L-leucyl-L-threonyl-L-valine
N-[3-({[N-{2-[(alpha-Glu-Leu-Ala)NH]ethyl}-N-(indol-3-ylacetyl)Gly]amino}methyl)benzoyl]-Leu-Thr-Val
N-[3-({[N-{2-[(glutamylleucylalanyl)amino]ethyl}-N-(indol-3-ylacetyl)glycyl]amino}methyl)benzoyl]leucylthreonylvaline