Feedback

 

N-[3-({[N-{2-[(beta-Ala-Leu-Ala)NH]ethyl}-N-(indol-3-ylacetyl)Gly]amino}methyl)benzoyl]-Leu-Thr-Val

Image of MNXM63349
Properties
MNX_IDMNXM63349
formulaC49H72N10O11
charge0
mass977.1564
referencechebi:63865
InChIKeyWOSAWXVQAPBYQA-PSUYFUFXSA-N
InChIInChI=1S/C49H72N10O11/c1-27(2)20-37(55-39(61)16-17-50)46(66)54-30(7)44(64)51-18-19-59(41(63)23-34-25-52-36-15-10-9-14-35(34)36)26-40(62)53-24-32-12-11-13-33(22-32)45(65)56-38(21-28(3)4)47(67)58-43(31(8)60)48(68)57-42(29(5)6)49(69)70/h9-15,22,25,27-31,37-38,42-43,52,60H,16-21,23-24,26,50H2,1-8H3,(H,51,64)(H,53,62)(H,54,66)(H,55,61)(H,56,65)(H,57,68)(H,58,67)(H,69,70)/t30-,31+,37-,38-,42-,43-/m0/s1
SMILESCC(C)C[C@H](NC(=O)CC[NH3+])C(=O)N[C@@H](C)C(=O)NCCN(CC(=O)NCc1cccc(c1)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H]([C@@H](C)O)C(=O)N[C@@H](C(C)C)C([O-])=O)C(=O)Cc1c[nH]c2ccccc12

This chemical compound does not exist in my selection



Occurrences of N-[3-({[N-{2-[(beta-Ala-Leu-Ala)NH]ethyl}-N-(indol-3-ylacetyl)Gly]amino}methyl)benzoyl]-Leu-Thr-Val in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
chebi:63865 N-[3-({[N-{2-[(beta-Ala-Leu-Ala)NH]ethyl}-N-(indol-3-ylacetyl)Gly]amino}methyl)benzoyl]-Leu-Thr-Val
N-[3-({[N-{2-[(beta-alanyl-L-leucyl-L-alanyl)amino]ethyl}-N-(1H-indol-3-ylacetyl)glycyl]amino}methyl)benzoyl]-L-leucyl-L-threonyl-L-valine
N-[3-({[N-{2-[(beta-alanylleucylalanyl)amino]ethyl}-N-(indol-3-ylacetyl)glycyl]amino}methyl)benzoyl]leucylthreonylvaline
WOSAWXVQAPBYQA-PSUYFUFXSA-N
betaALA-NH-(CH2)2-(COCH2indole)G-(3-aminomethylbenzoic acid)-LTV