Feedback

 

N-[6-(DNCP-amino)hexanoyl]-beta-D-glucosamine

Image of MNXM63365
Properties
MNX_IDMNXM63365
formulaC19H25N4O12
charge-1
mass501.4219
referencechebi:63119
InChIKeyACEVZSZSKUVYND-QLXPXKAKSA-M
InChIInChI=1S/C19H26N4O12/c24-8-12-16(26)17(27)15(19(30)35-12)21-13(25)4-2-1-3-5-20-14-10(18(28)29)6-9(22(31)32)7-11(14)23(33)34/h6-7,12,15-17,19-20,24,26-27,30H,1-5,8H2,(H,21,25)(H,28,29)/p-1/t12-,15-,16-,17-,19-/m1/s1
SMILESOC[C@H]1O[C@@H](O)[C@H](NC(=O)CCCCCNc2c(cc(cc2[N+]([O-])=O)[N+]([O-])=O)C([O-])=O)[C@@H](O)[C@@H]1O

This chemical compound does not exist in my selection



Occurrences of N-[6-(DNCP-amino)hexanoyl]-beta-D-glucosamine in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
chebi:63119 2-({6-[(2-carboxy-4,6-dinitrophenyl)amino]hexanoyl}amino)-2-deoxy-beta-D-glucopyranose
ACEVZSZSKUVYND-QLXPXKAKSA-N
N-[6-(DNCP-amino)hexanoyl]-beta-D-glucosamine