Feedback

 

N-{(3R,4R)-4-[({4-[(2-hydroxy-5-piperidin-1-ylphenyl)carbonyl]phenyl}carbonyl)amino]azepan-3-yl}isonicotinamide

Image of MNXM63371
Properties
MNX_IDMNXM63371
formulaC31H36N5O4
charge1
mass542.6481
referencechebi:45336
InChIKeyVXVVBHZWCMDJPJ-KAYWLYCHSA-O
InChIInChI=1S/C31H35N5O4/c37-28-11-10-24(36-17-2-1-3-18-36)19-25(28)29(38)21-6-8-22(9-7-21)30(39)34-26-5-4-14-33-20-27(26)35-31(40)23-12-15-32-16-13-23/h6-13,15-16,19,26-27,33,37H,1-5,14,17-18,20H2,(H,34,39)(H,35,40)/p+1/t26-,27-/m1/s1
SMILES[H][C@]1(CCC[NH2+]C[C@@]1([H])NC(=O)c1ccncc1)NC(=O)c1ccc(cc1)C(=O)c1cc(ccc1O)N1CCCCC1

This chemical compound does not exist in my selection



Occurrences of N-{(3R,4R)-4-[({4-[(2-hydroxy-5-piperidin-1-ylphenyl)carbonyl]phenyl}carbonyl)amino]azepan-3-yl}isonicotinamide in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
chebi:45336 N-(4-{[4-(2-HYDROXY-5-PIPERIDIN-1-YLBENZOYL)BENZOYL]AMINO}AZEPAN-3-YL)ISONICOTINAMIDE
N-{(3R,4R)-4-[({4-[(2-hydroxy-5-piperidin-1-ylphenyl)carbonyl]phenyl}carbonyl)amino]azepan-3-yl}isonicotinamide
N-{(3R,4R)-4-[({4-[(2-hydroxy-5-piperidin-1-ylphenyl)carbonyl]phenyl}carbonyl)amino]azepan-3-yl}pyridine-4-carboxamide
VXVVBHZWCMDJPJ-KAYWLYCHSA-N