Feedback

 

N-{3-[(E)-(tert-butoxyimino)methyl]-4-chlorophenyl}-2-methylfuran-3-carbothioamide

Image of MNXM63383
Properties
MNX_IDMNXM63383
formulaC17H19ClN2O2S
charge0
mass350.863
referencechebi:47715
InChIKeyPLGIIOKXCKDKEU-VXLYETTFSA-N
InChIInChI=1S/C17H19ClN2O2S/c1-11-14(7-8-21-11)16(23)20-13-5-6-15(18)12(9-13)10-19-22-17(2,3)4/h5-10H,1-4H3,(H,20,23)/b19-10+
SMILES[H]\C(=N/OC(C)(C)C)c1cc(NC(=S)c2ccoc2C)ccc1Cl

This chemical compound does not exist in my selection



Occurrences of N-{3-[(E)-(tert-butoxyimino)methyl]-4-chlorophenyl}-2-methylfuran-3-carbothioamide in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
chebi:47715 N-{3-[(E)-(tert-butoxyimino)methyl]-4-chlorophenyl}-2-methylfuran-3-carbothioamide
PLGIIOKXCKDKEU-VXLYETTFSA-N