Feedback

 

N-{3-[3-(dimethylamino)propyl]-5-(trifluoromethyl)phenyl}-4-methyl-3-[(3-pyrimidin-4-ylpyridin-2-yl)amino]benzamide

Image of MNXM63384
Properties
MNX_IDMNXM63384
formulaC29H30F3N6O
charge1
mass535.5828
referencechebi:45275
InChIKeyOHHGYJBFPVJURR-UHFFFAOYSA-O
InChIInChI=1S/C29H29F3N6O/c1-19-8-9-21(16-26(19)37-27-24(7-4-11-34-27)25-10-12-33-18-35-25)28(39)36-23-15-20(6-5-13-38(2)3)14-22(17-23)29(30,31)32/h4,7-12,14-18H,5-6,13H2,1-3H3,(H,34,37)(H,36,39)/p+1
SMILESC[NH+](C)CCCc1cc(cc(c1)C(F)(F)F)[NH+]=C([O-])c1ccc(C)c(Nc2ncccc2-c2ccncn2)c1

This chemical compound does not exist in my selection



Occurrences of N-{3-[3-(dimethylamino)propyl]-5-(trifluoromethyl)phenyl}-4-methyl-3-[(3-pyrimidin-4-ylpyridin-2-yl)amino]benzamide in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
chebi:45275 N-{3-[3-(DIMETHYLAMINO)PROPYL]-5-(TRIFLUOROMETHYL)PHENYL}-4-METHYL-3-[(3-PYRIMIDIN-4-YLPYRIDIN-2-YL)AMINO]BENZAMIDE
N-{3-[3-(dimethylamino)propyl]-5-(trifluoromethyl)phenyl}-4-methyl-3-[(3-pyrimidin-4-ylpyridin-2-yl)amino]benzamide
OHHGYJBFPVJURR-UHFFFAOYSA-N