Feedback

 

N-{3-[4-(3-aminopropyl)piperazin-1-yl]propyl}-3-nitro-5-(alpha-D-galactopyranosyl)benzamide

Image of MNXM63386
Properties
MNX_IDMNXM63386
formulaC23H39N5O9
charge2
mass529.5828
referencechebi:43535
InChIKeyUEIGEWJJVQHIAX-MKQKURRLSA-P
InChIInChI=1S/C23H37N5O9/c24-3-1-5-26-7-9-27(10-8-26)6-2-4-25-22(33)15-11-16(28(34)35)13-17(12-15)36-23-21(32)20(31)19(30)18(14-29)37-23/h11-13,18-21,23,29-32H,1-10,14,24H2,(H,25,33)/p+2/t18-,19+,20+,21-,23+/m1/s1
SMILES[H][C@]1(CO)O[C@]([H])(Oc2cc(cc(c2)N(=O)=O)C([O-])=[NH+]CCC[NH+]2CCN(CCC[NH3+])CC2)[C@]([H])(O)[C@@]([H])(O)[C@@]1([H])O

This chemical compound does not exist in my selection



Occurrences of N-{3-[4-(3-aminopropyl)piperazin-1-yl]propyl}-3-nitro-5-(alpha-D-galactopyranosyl)benzamide in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
chebi:43535 N-{3-[4-(3-AMINO-PROPYL)-PIPERAZIN-1-YL]-PROPYL}-3-NITRO-5-(GALACTOPYRANOSYL)-ALPHA-BENZAMIDE
N-{3-[4-(3-aminopropyl)piperazin-1-yl]propyl}-3-(alpha-D-galactopyranosyloxy)-5-nitrobenzamide
N-{3-[4-(3-aminopropyl)piperazin-1-yl]propyl}-3-nitro-5-(alpha-D-galactopyranosyl)benzamide
UEIGEWJJVQHIAX-MKQKURRLSA-N