Feedback

 

N-{4-[1-(phenylcarbonyl)piperidin-4-yl]butyl}-3-pyridin-3-ylpropanamide

Image of MNXM63389
Properties
MNX_IDMNXM63389
formulaC24H31N3O2
charge0
mass393.5218
referencechebi:41973
InChIKeyUKQGSFUTDYQJST-UHFFFAOYSA-N
InChIInChI=1S/C24H31N3O2/c28-23(12-11-21-8-6-15-25-19-21)26-16-5-4-7-20-13-17-27(18-14-20)24(29)22-9-2-1-3-10-22/h1-3,6,8-10,15,19-20H,4-5,7,11-14,16-18H2,(H,26,28)
SMILES[O-]C(CCc1cccnc1)=[NH+]CCCCC1CCN(CC1)C(=O)c1ccccc1

This chemical compound does not exist in my selection



Occurrences of N-{4-[1-(phenylcarbonyl)piperidin-4-yl]butyl}-3-pyridin-3-ylpropanamide in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
chebi:41973 N-[4-(1-BENZOYLPIPERIDIN-4-YL)BUTYL]-3-PYRIDIN-3-YLPROPANAMIDE
N-{4-[1-(phenylcarbonyl)piperidin-4-yl]butyl}-3-pyridin-3-ylpropanamide
UKQGSFUTDYQJST-UHFFFAOYSA-N