Feedback

 

N-{5-[(7-{[(2S)-2-hydroxy-3-piperidin-1-ylpropyl]oxy}-6-methoxyquinazolin-4-yl)amino]pyrimidin-2-yl}benzamide

Image of MNXM63394
Properties
MNX_IDMNXM63394
formulaC28H31N7O4
charge0
mass529.5902
referencechebi:43142
InChIKeyWHHFZOIADLFZRX-NRFANRHFSA-N
InChIInChI=1S/C28H31N7O4/c1-38-24-12-22-23(13-25(24)39-17-21(36)16-35-10-6-3-7-11-35)31-18-32-26(22)33-20-14-29-28(30-15-20)34-27(37)19-8-4-2-5-9-19/h2,4-5,8-9,12-15,18,21,36H,3,6-7,10-11,16-17H2,1H3,(H,31,32,33)(H,29,30,34,37)/t21-/m0/s1
SMILES[H][C@@](O)(COc1cc2ncnc(Nc3cnc(N=C([O-])c4ccccc4)nc3)c2cc1OC)C[NH+]1CCCCC1

This chemical compound does not exist in my selection



Occurrences of N-{5-[(7-{[(2S)-2-hydroxy-3-piperidin-1-ylpropyl]oxy}-6-methoxyquinazolin-4-yl)amino]pyrimidin-2-yl}benzamide in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
chebi:43142 N-{5-[(7-{[(2S)-2-hydroxy-3-piperidin-1-ylpropyl]oxy}-6-methoxyquinazolin-4-yl)amino]pyrimidin-2-yl}benzamide
WHHFZOIADLFZRX-NRFANRHFSA-N