Feedback

 

N-{[(2R,3R,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)pyrrolidin-2-yl]methyl}-4-(dimethylamino)benzamide

Image of MNXM63398
Properties
MNX_IDMNXM63398
formulaC15H24N3O4
charge1
mass310.3682
referencechebi:44059
InChIKeyOULLPOCYJLHTGG-AAVRWANBSA-O
InChIInChI=1S/C15H23N3O4/c1-18(2)10-5-3-9(4-6-10)15(22)16-7-11-13(20)14(21)12(8-19)17-11/h3-6,11-14,17,19-21H,7-8H2,1-2H3,(H,16,22)/p+1/t11-,12-,13-,14-/m1/s1
SMILES[H][C@]1(CO)[NH2+][C@]([H])(CNC(=O)c2ccc(cc2)N(C)C)[C@@]([H])(O)[C@]1([H])O

This chemical compound does not exist in my selection



Occurrences of N-{[(2R,3R,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)pyrrolidin-2-yl]methyl}-4-(dimethylamino)benzamide in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
chebi:44059 N-{[(2R,3R,4R,5R)-3,4-DIHYDROXY-5-(HYDROXYMETHYL)PYRROLIDIN-2-YL]METHYL}-4-(DIMETHYLAMINO)BENZAMIDE
N-{[(2R,3R,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)pyrrolidin-2-yl]methyl}-4-(dimethylamino)benzamide
OULLPOCYJLHTGG-AAVRWANBSA-N