Feedback

 

N-{[(2S)-1-(N-{[cis-4-(carbamimidamidomethyl)cyclohexyl]carbonyl}-3-cyclohexyl-D-alanyl)azetidin-2-yl]carbonyl}-D-tyrosyl-N(6)-carbamimidoyl-L-lysinamide

Image of MNXM63399
Properties
MNX_IDMNXM63399
formulaC38H63N11O6
charge2
mass769.9758
referencechebi:42669
InChIKeyPCCHJIAHIWBHDQ-QULKKBHESA-P
InChIInChI=1S/C38H61N11O6/c39-32(51)28(8-4-5-18-44-37(40)41)46-34(53)29(20-24-11-15-27(50)16-12-24)47-35(54)31-17-19-49(31)36(55)30(21-23-6-2-1-3-7-23)48-33(52)26-13-9-25(10-14-26)22-45-38(42)43/h11-12,15-16,23,25-26,28-31,50H,1-10,13-14,17-22H2,(H2,39,51)(H,46,53)(H,47,54)(H,48,52)(H4,40,41,44)(H4,42,43,45)/p+2/t25-,26-,28-,29+,30+,31-/m0/s1
SMILES[H][C@@](CCCCNC(N)=[NH2+])([NH+]=C([O-])[C@@]([H])(Cc1ccc(O)cc1)[NH+]=C([O-])[C@]1([H])CCN1C(=O)[C@@]([H])(CC1CCCCC1)[NH+]=C([O-])[C@@]1([H])CC[C@]([H])(CNC(N)=[NH2+])CC1)C([O-])=[NH2+]

This chemical compound does not exist in my selection



Occurrences of N-{[(2S)-1-(N-{[cis-4-(carbamimidamidomethyl)cyclohexyl]carbonyl}-3-cyclohexyl-D-alanyl)azetidin-2-yl]carbonyl}-D-tyrosyl-N(6)-carbamimidoyl-L-lysinamide in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
chebi:42669 N-{[(2S)-1-(N-{[cis-4-(carbamimidamidomethyl)cyclohexyl]carbonyl}-3-cyclohexyl-D-alanyl)azetidin-2-yl]carbonyl}-D-tyrosyl-N(6)-carbamimidoyl-L-lysinamide
N-{[(2S)-1-(N-{[cis-4-(carbamimidamidomethyl)cyclohexyl]carbonyl}-3-cyclohexyl-D-alanyl)azetidin-2-yl]carbonyl}-D-tyrosyl-N~6~-carbamimidoyl-L-lysinamide
PCCHJIAHIWBHDQ-QULKKBHESA-N