Feedback

 

N-acetyl-S-phenacyl-L-cysteine

Image of MNXM63540
Properties
MNX_IDMNXM63540
formulaC13H14NO4S
charge-1
mass280.32
referencechebi:59632
InChIKeyGBXIYVFOFVBRGY-NSHDSACASA-M
InChIInChI=1S/C13H15NO4S/c1-9(15)14-11(13(17)18)7-19-8-12(16)10-5-3-2-4-6-10/h2-6,11H,7-8H2,1H3,(H,14,15)(H,17,18)/p-1/t11-/m0/s1
SMILESCC(=O)N[C@@H](CSCC(=O)c1ccccc1)C([O-])=O

This chemical compound does not exist in my selection



Occurrences of N-acetyl-S-phenacyl-L-cysteine in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
chebi:59632 (2R)-2-acetamido-3-(2-oxo-2-phenylethyl)sulfanylpropanoic acid
(2R)-2-acetamido-3-(2-oxo-2-phenylethyl)sulfanylpropionic acid
(2R)-2-acetamido-3-phenacylsulfanylpropanoic acid
(2R)-2-acetamido-3-phenacylsulfanylpropionic acid
GBXIYVFOFVBRGY-NSHDSACASA-N
N-acetyl-S-(2-oxo-2-phenylethyl)-L-cysteine
N-acetyl-S-phenacyl-L-cysteine