Feedback

(3Z)-2-oxohex-3-enedioate

PropertiesImageOccurences in reactions
MNX_IDMNXM656Image of MNXM656
#reac
in my sandbox 0
in MNXref (generic)3
in models (compartimentalized) 0
formulaC6H4O5
charge-2
mass156.09296
referencechebi:64011
InChIKeyQTHJXLFFFTVYJC-UPHRSURJSA-L
InChIInChI=1S/C6H6O5/c7-4(6(10)11)2-1-3-5(8)9/h1-2H,3H2,(H,8,9)(H,10,11)/p-2/b2-1-
SMILES[O-]C(=O)C\C=C/C(=O)C([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:64011
chebi:64011
(3Z)-2-oxohex-3-enedioate
(3Z)-5-oxohex-3-enedioate
metacyc.compound:CPD-9167
metacycM:CPD-9167
seed.compound:cpd25593
seedM:cpd25593
(3Z)-2-oxohex-3-enedioate
CHEBI:64038
chebi:64038
(3Z)-2-oxohex-3-enedioic acid
(Z)-2-oxo-3-hexenedioic acid
chebi:64015
seedM:M_cpd25593
secondary/obsolete/fantasy identifier