Feedback

(S)-3-amino-2-methylpropanoate

Properties
MNX_IDMNXM732376
formulaC4H9NO2
charge0
mass103.1198
referencechebi:58655
Image of MNXM732376
InChIKeyQCHPKSFMDHPSNR-VKHMYHEASA-N
InChIInChI=1S/C4H9NO2/c1-3(2-5)4(6)7/h3H,2,5H2,1H3,(H,6,7)/t3-/m0/s1
SMILESC[C@@H](C[NH3+])C([O-])=O

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref8
Distinct compatimentalized reactions in models10

Similar chemical compounds in external resources
IdentifierDescription
metacycM:CPD-466 (S)-3-amino-2-methylpropanoate
(S)-3-amino-isobutyric acid
L-3-amino-isobutanoate
hmdb:HMDB0002166 (S)-b-aminoisobutyric acid
(+)-a-Methyl-b-alanine
(+)-alpha-Methyl-beta-alanine
(+)-alpha-methyl-beta-alanine
(+)-b-Aminoisobutyric acid
(+)-beta-Aminoisobutyric acid
(2S)-3-amino-2-methylpropanoic acid
(S)-3-amino-2-Methyl-propanoate
(S)-3-amino-2-Methyl-propanoic acid
(S)-3-amino-2-Methylpropanoate
(S)-3-amino-2-Methylpropanoic acid
(S)-3-amino-Isobutanoate
(S)-3-amino-Isobutanoic acid
(S)-3-amino-Isobutyrate
(S)-3-amino-Isobutyric acid
(S)-b-Aminoisobutyrate
(S)-beta-Aminoisobutyrate
(S)-beta-Aminoisobutyric acid
(S)-beta-aminoisobutyrate
(S)-beta-aminoisobutyric acid
L-2-Methyl-b-alanine
L-2-Methyl-beta-alanine
L-3-amino-2-Methylpropanoate
L-3-amino-2-Methylpropanoic acid
L-3-amino-2-Methylpropionic acid
L-3-amino-Isobutanoate
L-3-amino-Isobutanoic acid
L-3-amino-Isobutyrate
L-3-amino-Isobutyric acid
L-b-Aminoisobutyrate
L-b-Aminoisobutyric acid
L-beta-Aminoisobutyrate
L-beta-Aminoisobutyric acid
S-b-Aminoisobutyrate
S-beta-Aminoisobutyrate
S-beta-Aminoisobutyric acid
biggM:M_3aib
chebi:11043
chebi:18745
chebi:390
chebi:41058
chebi:6167
hmdb:HMDB02166
keggC:M_C03284
seedM:M_cpd02096
secondary/obsolete/fantasy identifier
lipidmaps:LMFA01100050 (S)-b-amino-isobutyric acid
2S-methyl-3-amino-propanoic acid
chebi:58655 (S)-3-amino-2-methylpropanoate
(2S)-3-azaniumyl-2-methylpropanoate
(S)-3-aminoisobutyric acid zwitterion
chebi:18188 (S)-3-aminoisobutyrate
(2S)-3-amino-2-methylpropanoate
(S)-3-Amino-2-methylpropanoate
(S)-3-Amino-isobutanoate
(S)-3-Amino-isobutyrate
(S)-beta-aminoisobutyrate
BETA-AMINO ISOBUTYRATE
L-3-Amino-isobutanoate
L-3-Amino-isobutyrate
L-3-aminoisobutyrate
chebi:33094 (S)-3-aminoisobutyric acid
(2S)-3-amino-2-methylpropanoic acid
(S)-3-amino-2-methylpropanoic acid
(S)-3-amino-isobutanoic acid
(S)-3-amino-isobutyric acid
(S)-beta-aminoisobutyric acid
L-3-amino-isobutanoic acid
L-3-amino-isobutyric acid
seedM:cpd02096 L-3-Amino-isobutyrate
(S)-3-Amino-2-methylpropanoate
(S)-3-Amino-isobutanoate
(S)-3-Amino-isobutyrate
(S)-3-amino-2-methylpropanoate
(S)-3-amino-isobutyric acid
L-3-Amino-isobutanoate
L-3-amino-isobutanoate
keggC:C03284 L-3-Aminoisobutanoate
(S)-3-Amino-2-methylpropanoate
(S)-3-Aminoisobutanoate
(S)-3-Aminoisobutyrate
(S)-beta-Aminoisobutyrate
L-3-Aminoisobutyrate
biggM:3aib L-3-Amino-isobutanoate
sabiorkM:6526 L-3-Amino-isobutanoate
(S)-3-Amino-2-methylpropanoate
(S)-3-Amino-isobutanoate
(S)-3-Amino-isobutyrate
L-3-Amino-isobutyrate
MNXM2053is deprecated and replaced by MNXM732375 ((R)-3-amino-2-methylpropanoate)
MNXM2053is deprecated and replaced by this entry
MNXM786is deprecated and replaced by MNXM732375 ((R)-3-amino-2-methylpropanoate)
MNXM786is deprecated and replaced by this entry
MNXM89912is deprecated and replaced by MNXM786