Feedback

 

UDP-N-acetylmuramic acid

Image of MNXM785
Properties
MNX_IDMNXM785
formulaC20H28N3O19P2
charge-3
mass676.3942
referencechebi:17882
InChIKeyNQBRVZNDBBMBLJ-VZUUOWJQSA-K
InChIInChI=1S/C20H31N3O19P2/c1-7(18(30)31)38-16-12(21-8(2)25)19(40-9(5-24)14(16)28)41-44(35,36)42-43(33,34)37-6-10-13(27)15(29)17(39-10)23-4-3-11(26)22-20(23)32/h3-4,7,9-10,12-17,19,24,27-29H,5-6H2,1-2H3,(H,21,25)(H,30,31)(H,33,34)(H,35,36)(H,22,26,32)/p-3/t7-,9-,10-,12-,13-,14-,15-,16-,17-,19?/m1/s1
SMILESC[C@@H](O[C@H]1[C@H](O)[C@@H](CO)OC(OP([O-])(=O)OP([O-])(=O)OC[C@H]2O[C@H]([C@H](O)[C@@H]2O)n2ccc(=O)[nH]c2=O)[C@@H]1NC(C)=O)C([O-])=O

This chemical compound does not exist in my selection



Occurrences of UDP-N-acetylmuramic acid in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
bigg:uamr UDP-N-acetylmuramate
chebi:58309 NQBRVZNDBBMBLJ-VZUUOWJQSA-K
UDP-N-acetylmuramate
UDP-N-acetylmuramate trianion
UDP-N-acetylmuramate(3-)
uridine 5'-(3-{2-acetylamino-3-O-[(R)-1-carboxylatoethyl]-2-deoxy-D-glucopyranosyl} diphosphate)
chebi:13458
chebi:13477
chebi:17882
chebi:22120
chebi:9827
NQBRVZNDBBMBLJ-VZUUOWJQSA-N
UDP-N-acetylmuramic acid
uridine 5'-(3-{2-acetylamino-3-O-[(R)-1-carboxyethyl]-2-deoxy-D-glucopyranosyl} dihydrogen diphosphate)
kegg:C01050 UDP-MurNAc
UDP-N-acetyl-alpha-D-muramate
UDP-N-acetylmuramate
UDP-N-acetylmuramic acid
sabiork:2230 UDP-MurNAc
UDP-N-acetylmuramate
UDP-N-acetylmuramic acid