Feedback

(R)-3-Ureidoisobutyrate

PropertiesImageOccurences in reactions
MNX_IDMNXM1015Image of MNXM1015
#reac
in my sandbox 0
in MNXref (generic)6
in models (compartimentalized) 6
formulaC5H9N2O3
charge-1
mass145.13664
referencekeggC:C21029
InChIKeyPHENTZNALBMCQD-GSVOUGTGSA-M
InChIInChI=1S/C5H10N2O3/c1-3(4(8)9)2-7-5(6)10/h3H,2H2,1H3,(H,8,9)(H3,6,7,10)/p-1/t3-/m1/s1
SMILESC[C@H](CNC(N)=O)C([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
kegg.compound:C21029
keggC:C21029
(R)-3-Ureidoisobutyrate
(R)-N-Carbamyl-beta-aminoisobutyrate
metacyc.compound:3-UREIDO-ISOBUTYRATE
metacycM:3-UREIDO-ISOBUTYRATE
3-(carbamoylamino)-2-methylpropanoate
(R)-3-ureido-isobutanoate
(R)-3-ureido-isobutyrate
N-carbamyl-beta-aminoisobutyrate
N-carbamyl-beta-aminoisobutyric acid
CHEBI:74414
chebi:74414
3-(carbamoylamino)-2-methylpropanoate
3-ureidoisobutyrate(1-)
bigg.metabolite:3uib
biggM:3uib
sabiork.compound:2926
sabiorkM:2926
kegg.compound:C05100
keggC:C05100
3-Ureidoisobutyrate
seed.compound:cpd03034
seedM:cpd03034
3-Ureidoisobutyrate
(R)-3-ureido-isobutanoate
(R)-3-ureido-isobutyrate
3-(carbamoylamino)-2-methylpropanoate
3-ureido-isobutyrate
3uib
N-carbamyl-beta-aminoisobutyrate
N-carbamyl-beta-aminoisobutyric acid
reactome:R-ALL-73617
reactomeM:R-ALL-73617
CHEBI:1670
chebi:1670
3-ureidoisobutyric acid
3-((aminocarbonyl)amino)-2-methylpropanoic acid
3-Ureidoisobutyrate
3-carbamoylamino-2-methylpropanoic acid
beta-UBA
beta-ureidoisobutyric acid
hmdb:HMDB0002031 Ureidoisobutyric acid
3-((Aminocarbonyl)amino)-2-methylpropanoate
3-((Aminocarbonyl)amino)-2-methylpropanoic acid
3-(carbamoylamino)-2-methylpropanoic acid
3-Ureidoisobutyrate
3-Ureidoisobutyric acid
3-carbamoylamino-2-Methylpropanoate
3-carbamoylamino-2-Methylpropanoic acid
DL-beta-Ureidoisobutyrate
DL-beta-Ureidoisobutyric acid
N-Carbamyl-amino isobutyrate
N-Carbamyl-b-aminoisobutyric acid
N-Carbamyl-beta-aminoisobutyric acid
Ureidoisobutyrate
b-UBA
b-Ureidoisobutyrate
b-Ureidoisobutyric acid
beta-UBA
beta-Ureidoisobutyrate
beta-Ureidoisobutyric acid
beta-uba
beta-ureidoisobutyrate
beta-ureidoisobutyric acid
hmdb:HMDB02031
biggM:M_3uib
keggC:M_C05100
keggC:M_C21029
seedM:M_cpd03034
secondary/obsolete/fantasy identifier