Feedback

(R)-3-Ureidoisobutyrate

Properties
MNX_IDMNXM1015
formulaC5H10N2O3
charge0
mass146.14458
referencekeggC:C21029
Image of MNXM1015
InChIKeyPHENTZNALBMCQD-GSVOUGTGSA-N
InChIInChI=1S/C5H10N2O3/c1-3(4(8)9)2-7-5(6)10/h3H,2H2,1H3,(H,8,9)(H3,6,7,10)/t3-/m1/s1
SMILESC[C@H](CNC(N)=O)C(O)=O

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref6
Distinct compatimentalized reactions in models6

Similar chemical compounds in external resources
IdentifierDescription
biggM:M_3uib
hmdb:HMDB02031
keggC:M_C05100
keggC:M_C21029
seedM:M_cpd03034
secondary/obsolete/fantasy identifier
metacycM:3-UREIDO-ISOBUTYRATE 3-(carbamoylamino)-2-methylpropanoate
(R)-3-ureido-isobutanoate
(R)-3-ureido-isobutyrate
N-carbamyl-beta-aminoisobutyrate
N-carbamyl-beta-aminoisobutyric acid
biggM:3uib
keggC:C05100
sabiorkM:2926
3-Ureidoisobutyrate
chebi:74414 3-(carbamoylamino)-2-methylpropanoate
3-ureidoisobutyrate(1-)
seedM:cpd03034 3-Ureidoisobutyrate
(R)-3-ureido-isobutanoate
(R)-3-ureido-isobutyrate
3-(carbamoylamino)-2-methylpropanoate
3-ureido-isobutyrate
3uib
N-carbamyl-beta-aminoisobutyrate
N-carbamyl-beta-aminoisobutyric acid
chebi:1670
reactome:R-ALL-73617
3-ureidoisobutyric acid
3-((aminocarbonyl)amino)-2-methylpropanoic acid
3-Ureidoisobutyrate
3-carbamoylamino-2-methylpropanoic acid
beta-UBA
beta-ureidoisobutyric acid
hmdb:HMDB0002031 Ureidoisobutyric acid
3-((Aminocarbonyl)amino)-2-methylpropanoate
3-((Aminocarbonyl)amino)-2-methylpropanoic acid
3-(carbamoylamino)-2-methylpropanoic acid
3-Ureidoisobutyrate
3-Ureidoisobutyric acid
3-carbamoylamino-2-Methylpropanoate
3-carbamoylamino-2-Methylpropanoic acid
DL-beta-Ureidoisobutyrate
DL-beta-Ureidoisobutyric acid
N-Carbamyl-amino isobutyrate
N-Carbamyl-b-aminoisobutyric acid
N-Carbamyl-beta-aminoisobutyric acid
Ureidoisobutyrate
b-UBA
b-Ureidoisobutyrate
b-Ureidoisobutyric acid
beta-UBA
beta-Ureidoisobutyrate
beta-Ureidoisobutyric acid
beta-uba
beta-ureidoisobutyrate
beta-ureidoisobutyric acid
keggC:C21029 (R)-3-Ureidoisobutyrate
(R)-N-Carbamyl-beta-aminoisobutyrate
MNXM163065is deprecated and replaced by this entry
MNXM722406is deprecated and replaced by this entry