Feedback

glutarate

PropertiesImageOccurences in reactions
MNX_IDMNXM1021Image of MNXM1021
#reac
in my sandbox 0
in MNXref (generic)28
in models (compartimentalized) 8
formulaC5H6O4
charge-2
mass130.09874
referencechebi:30921
InChIKeyJFCQEDHGNNZCLN-UHFFFAOYSA-L
InChIInChI=1S/C5H8O4/c6-4(7)2-1-3-5(8)9/h1-3H2,(H,6,7)(H,8,9)/p-2
SMILES[O-]C(=O)CCCC([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:30921
chebi:30921
glutarate
glutarate(2-)
pentanedioate
bigg.metabolite:glutar
biggM:glutar
SLM:000389477
slm:000389477
Glutarate
sabiork.compound:2058
sabiorkM:2058
kegg.compound:C00489
keggC:C00489
Glutarate
1,3-Propanedicarboxylic acid
Glutaric acid
Pentanedioic acid
seed.compound:cpd00379
seedM:cpd00379
Glutarate
1,3-Propanedicarboxylic acid
Glutaric acid
Pentanedioic acid
glutar
glutarate
glutaric acid
pentanedioate
hmdb:HMDB0000661 Glutaric acid
1,3-Propanedicarboxylate
1,3-Propanedicarboxylic acid
1,5-Pentanedioate
1,5-Pentanedioic acid
Glutarate
Glutarsaeure
Pentandioate
Pentandioic acid
Pentanedioate
Pentanedioic acid
glutaric acid
pentanedioic acid
envipath:...fc2b0ffccc58
envipathM:...fc2b0ffccc58
[Pentanedioic acid]
Glutaric acid
CHEBI:35907
chebi:35907
glutarate(1-)
4-carboxybutanoate
hydrogen glutarate
CHEBI:24329
chebi:24329
glutarate
glutarate anion
glutarates
glutaric acid anion
metacyc.compound:GLUTARATE
metacycM:GLUTARATE
glutarate
glutaric acid
pentanedioate
CHEBI:17859
chebi:17859
glutaric acid
1,3-Propanedicarboxylic acid
1,5-pentanedioic acid
GLUTARIC ACID
Glutaric acid
Glutarsaeure
Pentanedioic acid
pentanedioic acid
hmdb:HMDB00661
chebi:14322
chebi:24327
chebi:24330
chebi:30922
chebi:35906
chebi:43097
chebi:5434
biggM:M_glutar
keggC:M_C00489
seedM:M_cpd00379
secondary/obsolete/fantasy identifier