Feedback

glutarate

Properties
MNX_IDMNXM1021
formulaC5H6O4
charge-2
mass130.09874
referencechebi:30921
Image of MNXM1021
InChIKeyJFCQEDHGNNZCLN-UHFFFAOYSA-L
InChIInChI=1S/C5H8O4/c6-4(7)2-1-3-5(8)9/h1-3H2,(H,6,7)(H,8,9)/p-2
SMILES[O-]C(=O)CCCC([O-])=O

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref27
Distinct compatimentalized reactions in models8

Similar chemical compounds in external resources
IdentifierDescription
seedM:cpd00379 Glutarate
1,3-Propanedicarboxylic acid
Glutaric acid
Pentanedioic acid
glutar
glutarate
glutaric acid
pentanedioate
envipath:...fc2b0ffccc58 [Pentanedioic acid]
Glutaric acid
chebi:35907 glutarate(1-)
4-carboxybutanoate
hydrogen glutarate
hmdb:HMDB0000661 Glutaric acid
1,3-Propanedicarboxylate
1,3-Propanedicarboxylic acid
1,5-Pentanedioate
1,5-Pentanedioic acid
Glutarate
Glutarsaeure
Pentandioate
Pentandioic acid
Pentanedioate
Pentanedioic acid
glutaric acid
pentanedioic acid
keggC:C00489
sabiorkM:2058
Glutarate
1,3-Propanedicarboxylic acid
Glutaric acid
Pentanedioic acid
biggM:M_glutar
chebi:14322
chebi:24327
chebi:24330
chebi:30922
chebi:35906
chebi:43097
chebi:5434
hmdb:HMDB00661
keggC:M_C00489
seedM:M_cpd00379
secondary/obsolete/fantasy identifier
chebi:24329 glutarate
glutarate anion
glutarates
glutaric acid anion
chebi:30921 glutarate
glutarate(2-)
pentanedioate
metacycM:GLUTARATE glutarate
glutaric acid
pentanedioate
chebi:17859 glutaric acid
1,3-Propanedicarboxylic acid
1,5-pentanedioic acid
GLUTARIC ACID
Glutaric acid
Glutarsaeure
Pentanedioic acid
pentanedioic acid
biggM:glutar
slm:000389477
Glutarate