Feedback

(R)-lipoamide

PropertiesImageOccurences in reactions
MNX_IDMNXM1024Image of MNXM1024
#reac
in my sandbox 0
in MNXref (generic)40
in models (compartimentalized) 24
formulaC8H15NOS2
charge0
mass205.34284
referencechebi:83094
InChIKeyFCCDDURTIIUXBY-SSDOTTSWSA-N
InChIInChI=1S/C8H15NOS2/c9-8(10)4-2-1-3-7-5-6-11-12-7/h7H,1-6H2,(H2,9,10)/t7-/m1/s1
SMILESNC(=O)CCCC[C@@H]1CCSS1
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:83094
chebi:83094
(R)-lipoamide
5-[(3R)-1,2-dithiolan-3-yl]pentanamide
bigg.metabolite:lpam
biggM:lpam
Lipoamide
hmdb:HMDB0000962 Lipoamide
1,2-Dithiolane-3-pentanamide
1,2-Dithiolane-3-valeramide
5-(1,2-Dithiolan-3-yl)-pentanamide
5-(1,2-Dithiolan-3-yl)pentanamide
5-(1,2-Dithiolan-3-yl)valeramide
5-(1,2-dithiolan-3-yl)pentanamide
5-(Dithiolan-3-yl)valeramide
6,8-Thioctic amide
DL-6-Thioctic amide
DL-Lipoamide
Lipamide
Lipoacin
Lipoamid
Lipoamide, (+-)-isomer
Lipoicin
Lipozyme
Lypoaran
Pathoclon
Thioami
Thioctamid
Thioctamide
Thioctate amide
Thioctic acid amide
Thiotomin
Ticolin
Vitamin N
a-Lipoate amide
a-Lipoic acid amide
alpha-Lipoate
alpha-Lipoate amide
alpha-Lipoic acid
alpha-Lipoic acid amide
alpha-Lipoic amide
alpha-lipoate amide
alpha-lipoic acid amide
lipoamide
seed.compound:cpd00213
seedM:cpd00213
Lipoamide
5-(1,2-dithiolan-3-yl)-pentanamide
6,8-dithiooctanoic amide
DL-lipoamide
Thioctic acid amide
lipoamide
lpam
sabiork.compound:1320
sabiorkM:1320
kegg.compound:C00248
keggC:C00248
Lipoamide
Thioctic acid amide
kegg.drug:D00048
keggD:D00048
Thioctic acid amide (JAN)
Lipoamide
reactome:R-ALL-29824
reactomeM:R-ALL-29824
CHEBI:17460
chebi:17460
lipoamide
1,2-dithiolane-3-pentanamide
5-(1,2-dithiolan-3-yl)pentanamide
Lipoamide
Thioctamide
Thioctic acid amide
alpha-lipoic acid amide
lipoacin
vitamin N
metacyc.compound:LIPOAMIDE
metacycM:LIPOAMIDE
lipoamide
5-(1,2-dithiolan-3-yl)-pentanamide
6,8-dithiooctanoic amide
DL-lipoamide
lipidmaps:LMFA08010006
lipidmapsM:LMFA08010006
lipoamide
5-(1,2-dithiolan-3-yl)pentanamide
Lipoamide
Thioctamide
Thioctic acid amide
alpha-lipoic acid amide
lipoamide
vitamin N
hmdb:HMDB0006877
hmdb:HMDB0006950
hmdb:HMDB00962
hmdb:HMDB06877
hmdb:HMDB06950
chebi:14518
chebi:25055
chebi:6491
biggM:M_lpam
keggC:M_C00248
keggD:M_D00048
seedM:M_cpd00213
secondary/obsolete/fantasy identifier