Feedback

(2R,3S)-tartrate

PropertiesImageOccurences in reactions
MNX_IDMNXM1031Image of MNXM1031
#reac
in my sandbox 0
in MNXref (generic)6
in models (compartimentalized) 3
formulaC4H4O6
charge-2
mass148.07096
referencechebi:30928
InChIKeyFEWJPZIEWOKRBE-XIXRPRMCSA-L
InChIInChI=1S/C4H6O6/c5-1(3(7)8)2(6)4(9)10/h1-2,5-6H,(H,7,8)(H,9,10)/p-2/t1-,2+
SMILESO[C@@H]([C@@H](O)C([O-])=O)C([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:30928
chebi:30928
(2R,3S)-tartrate
(2R,3S)-2,3-dihydroxybutanedioate
(2R,3S)-2,3-dihydroxysuccinate
erythrarate
meso-tartrate(2-)
CHEBI:48930
chebi:48930
(2R,3S)-3-carboxy-2,3-dihydroxypropanoate
CHEBI:48931
chebi:48931
(2S,3R)-3-carboxy-2,3-dihydroxypropanoate
bigg.metabolite:tartr__M
biggM:tartr__M
Meso Tartaric acid
kegg.compound:C00552
keggC:C00552
meso-Tartaric acid
meso-Tartrate
seed.compound:cpd00432
seedM:cpd00432
meso-Tartrate
(2R,3S)-2,3-dihydroxybutanedioate
M-tartarate
erythrarate
meso-Tartaric acid
meso-tartaric acid
meso-tartrate
mesotartaric acid
tartr-M
CHEBI:15673
chebi:15673
meso-tartaric acid
(2R,3S)-2,3-dihydroxybutanedioic acid
(2R,3S)-2,3-dihydroxysuccinic acid
(2R,3S)-rel-2,3-dihydroxybutanedioic acid
(2R,3S)-tartaric acid
(R*,S*)-2,3-dihydroxybutanedioic acid
Mesoweinsaeure
S,R MESO-TARTARIC ACID
erythraric acid
internally compensated tartaric acid
m-tartaric acid
meso-Tartaric acid
mesotartaric acid
unresolvable tartaric acid
CHEBI:35400
chebi:35400
meso-tartrate(1-)
hydrogen (2R,3S)-2,3-dihydroxybutanedioate
rel-(2R,3S)-3-carboxy-2,3-dihydroxypropanoate
metacyc.compound:MESO-TARTRATE
metacycM:MESO-TARTRATE
meso-tartrate
(2R,3S)-2,3-dihydroxybutanedioate
M-tartarate
erythrarate
meso-tartaric acid
mesotartaric acid
chebi:10599
chebi:12824
chebi:25206
chebi:25207
chebi:45680
biggM:M_tartr__M
keggC:M_C00552
seedM:M_cpd00432
secondary/obsolete/fantasy identifier