Feedback

(2R)-2-O-(alpha-D-glucopyranosyl)-3-phospho-glycerate

Properties
MNX_IDMNXM1033
formulaC9H14O12P
charge-3
mass345.174021
referencechebi:62600
Image of MNXM1033
InChIKeyRJDBNSZFZDWPFL-CECBSOHTSA-K
InChIInChI=1S/C9H17O12P/c10-1-3-5(11)6(12)7(13)9(20-3)21-4(8(14)15)2-19-22(16,17)18/h3-7,9-13H,1-2H2,(H,14,15)(H2,16,17,18)/p-3/t3-,4-,5-,6+,7-,9-/m1/s1
SMILESOC[C@H]1O[C@H](O[C@H](COP([O-])([O-])=O)C([O-])=O)[C@H](O)[C@@H](O)[C@@H]1O

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref14
Distinct compatimentalized reactions in models0

Similar chemical compounds in external resources
IdentifierDescription
seedM:cpd21036 2-O-(alpha-D-Glucopyranosyl)-3-phospho-D-glycerate
(2R)-2-(alpha-D-Glucopyranosyloxy)-3-(phosphonooxy)propanoate
(2R)-2-(alpha-D-glucopyranosyloxy)-3-(phosphonooxy)propanoate
2-(alpha-D-glucopyranosyl)-3-phospho-D-glycerate
2-O-(alpha-D-glucopyranosyl)-3-phospho-D-glycerate
glucosyl-3-phsophoglycerate
chebi:62601 2-O-(alpha-D-glucopyranosyl)-3-O-phospho-D-glyceric acid
(2R)-2-(alpha-D-glucopyranosyloxy)-3-(phosphonooxy)propanoic acid
2-(alpha-D-glucopyranosyl)-3-phospho-D-glyceric acid
2-(alpha-D-glucosyl)-3-phospho-D-glyceric acid
2-O-(alpha-D-glucosyl)-3-O-phospho-D-glyceric acid
keggC:M_C19791
seedM:M_cpd21036
secondary/obsolete/fantasy identifier
keggC:C19791 2-O-(alpha-D-Glucopyranosyl)-3-phospho-D-glycerate
(2R)-2-(alpha-D-Glucopyranosyloxy)-3-(phosphonooxy)propanoate
metacycM:CPD-9189 2-O-(alpha-D-glucopyranosyl)-3-phospho-D-glycerate
2-(alpha-D-glucopyranosyl)-3-phospho-D-glycerate
glucosyl-3-phsophoglycerate
chebi:62600 (2R)-2-O-(alpha-D-glucopyranosyl)-3-phospho-glycerate
(2R)-2-(alpha-D-glucopyranosyloxy)-3-(phosphonatooxy)propanoate
2-O-(alpha-D-glucopyranosyl)-3-O-phosphonato-D-glycerate
2-O-(alpha-D-glucopyranosyl)-3-O-phosphonato-D-glycerate(3-)
2-O-(alpha-D-glucopyranosyl)-3-phospho-D-glycerate
2-O-(alpha-D-glucopyranosyl)-3-phospho-D-glycerate(3-)
2-O-(alpha-D-glucopyranosyl)-3-phosphonato-D-glycerate
2-O-(alpha-D-glucopyranosyl)-3-phosphonato-D-glycerate(3-)
2-O-(alpha-D-glucosyl)-3-O-phosphonato-D-glycerate
2-O-(alpha-D-glucosyl)-3-phospho-D-glycerate
2-O-(alpha-D-glucosyl)-3-phosphonato-D-glycerate