Feedback

5-guanidino-2-oxopentanoate

PropertiesImageOccurences in reactions
MNX_IDMNXM1037Image of MNXM1037
#reac
in my sandbox 0
in MNXref (generic)24
in models (compartimentalized) 20
formulaC6H11N3O3
charge0
mass173.08004
referencechebi:58489
InChIKeyARBHXJXXVVHMET-UHFFFAOYSA-N
InChIInChI=1S/C6H11N3O3/c7-6(8)9-3-1-2-4(10)5(11)12/h1-3H2,(H,11,12)(H4,7,8,9)
SMILESNC(=[NH2+])NCCCC(=O)C(=O)[O-]
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:58489
chebi:58489
5-guanidino-2-oxopentanoate
5-guanidino-2-oxopentanoic acid zwitterion
5-{[amino(iminio)methyl]amino}-2-oxopentanoate
seed.compound:cpd02364
seedM:cpd02364
2-Oxo-5-guanidinopentanoate
2-Oxo-5-guanidino-pentanoate
2-Oxoarginine
2-keto-5-guanidinovalerate
2-ketoarginine
2-oxo-5-guanidino-pentanoate
2-oxo-5-guanidinopentanoate
2-oxoarginine
5-Guanidino-2-oxo-pentanoate
5-Guanidino-2-oxopentanoate
5-carbamimidamido-2-oxopentanoate
5-guanidino-2-oxo-pentanoate
5-guanidino-2-oxopentanoate
alpha-ketoarginine
bigg.metabolite:5g2oxpt
biggM:5g2oxpt
2-Oxoarginine
hmdb:HMDB0004225 2-Oxoarginine
2-oxo-5-Guanidino-pentanoate
2-oxo-5-Guanidino-pentanoic acid
2-oxo-5-Guanidinopentanoate
2-oxo-5-Guanidinopentanoic acid
2-oxo-5-Guanidinovalerate
2-oxo-5-Guanidinovaleric acid
5-((Aminoiminomethyl)amino)-2-oxopentanoate
5-((Aminoiminomethyl)amino)-2-oxopentanoic acid
5-(Diaminomethylideneamino)-2-oxopentanoate
5-(Diaminomethylideneamino)-2-oxopentanoic acid
5-Guanidino-2-oxo-pentanoate
5-Guanidino-2-oxo-pentanoic acid
5-Guanidino-2-oxopentanoate
5-Guanidino-2-oxopentanoic acid
5-Guanidino-2-oxovaleric acid
5-[(diaminomethylidene)amino]-2-oxopentanoic acid
D-Guanidino-a-oxovaleric acid
D-Guanido-a-ketovaleric acid
a-Keto-D-guanidinovaleric acid
a-Keto-delta-guanidinopentanoate
a-Keto-delta-guanidinopentanoic acid
a-Keto-delta-guanidinovalerate
a-Keto-delta-guanidinovaleric acid
alpha-Keto-delta-guanidinopentanoate
alpha-Keto-delta-guanidinopentanoic acid
alpha-Keto-delta-guanidinovalerate
alpha-Keto-delta-guanidinovaleric acid
alpha-keto-delta-guanidinopentanoate
alpha-keto-delta-guanidinopentanoic acid
alpha-keto-delta-guanidinovalerate
alpha-keto-delta-guanidinovaleric acid
delta-Guanidino-alpha-oxovaleric acid
delta-Guanido-alpha-ketovaleric acid
seed.compound:cpd03528
seedM:cpd03528
2-Oxoarginine
oxoarg-L
sabiork.compound:6844
sabiorkM:6844
kegg.compound:C03771
keggC:C03771
5-Guanidino-2-oxopentanoate
2-Oxo-5-guanidino-pentanoate
2-Oxo-5-guanidinopentanoate
2-Oxoarginine
5-Guanidino-2-oxo-pentanoate
metacyc.compound:CPD-824
metacycM:CPD-824
5-guanidino-2-oxopentanoate
2-keto-5-guanidinovalerate
2-ketoarginine
2-oxo-5-guanidino-pentanoate
2-oxo-5-guanidinopentanoate
2-oxoarginine
5-carbamimidamido-2-oxopentanoate
alpha-ketoarginine
CHEBI:18253
chebi:18253
5-guanidino-2-oxopentanoate
2-oxo-5-guanidino-pentanoate
2-oxo-5-guanidinopentanoate
5-carbamimidamido-2-oxopentanoate
CHEBI:28116
chebi:28116
5-guanidino-2-oxopentanoic acid
2-Oxo-5-guanidino-pentanoate
2-Oxo-5-guanidinopentanoate
2-Oxoarginine
2-oxo-5-guanidinovaleric acid
5-((aminoiminomethyl)amino)-2-oxopentanoic acid
5-Guanidino-2-oxo-pentanoate
5-Guanidino-2-oxopentanoate
5-carbamimidamido-2-oxopentanoic acid
alpha-keto-delta-guanidinopentanoic acid
alpha-keto-delta-guanidinovaleric acid
hmdb:HMDB0006815
hmdb:HMDB04225
hmdb:HMDB06815
chebi:12129
chebi:1249
chebi:19740
chebi:20572
chebi:2060
biggM:M_5g2oxpt
keggC:M_C03771
seedM:M_cpd02364
seedM:M_cpd03528
secondary/obsolete/fantasy identifier