Feedback

5-guanidino-2-oxopentanoate

Properties
MNX_IDMNXM1037
formulaC6H11N3O3
charge0
mass173.16996
referencechebi:58489
Image of MNXM1037
InChIKeyARBHXJXXVVHMET-UHFFFAOYSA-N
InChIInChI=1S/C6H11N3O3/c7-6(8)9-3-1-2-4(10)5(11)12/h1-3H2,(H,11,12)(H4,7,8,9)
SMILESNC(=[NH2+])NCCCC(=O)C([O-])=O

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref24
Distinct compatimentalized reactions in models9

Similar chemical compounds in external resources
IdentifierDescription
seedM:cpd03528 2-Oxoarginine
oxoarg-L
chebi:58489 5-guanidino-2-oxopentanoate
5-guanidino-2-oxopentanoic acid zwitterion
5-{[amino(iminio)methyl]amino}-2-oxopentanoate
keggC:C03771
sabiorkM:6844
5-Guanidino-2-oxopentanoate
2-Oxo-5-guanidino-pentanoate
2-Oxo-5-guanidinopentanoate
2-Oxoarginine
5-Guanidino-2-oxo-pentanoate
metacycM:CPD-824 5-guanidino-2-oxopentanoate
2-keto-5-guanidinovalerate
2-ketoarginine
2-oxo-5-guanidino-pentanoate
2-oxo-5-guanidinopentanoate
2-oxoarginine
5-carbamimidamido-2-oxopentanoate
alpha-ketoarginine
hmdb:HMDB0004225 2-Oxoarginine
2-oxo-5-Guanidinopentanoate
2-oxo-5-Guanidinopentanoic acid
2-oxo-5-Guanidinovalerate
2-oxo-5-Guanidinovaleric acid
2-oxo-5-guanidino-Pentanoate
2-oxo-5-guanidino-Pentanoic acid
5-((Aminoiminomethyl)amino)-2-oxopentanoate
5-((Aminoiminomethyl)amino)-2-oxopentanoic acid
5-(diaminomethylideneamino)-2-Oxopentanoate
5-(diaminomethylideneamino)-2-Oxopentanoic acid
5-[(diaminomethylidene)amino]-2-oxopentanoic acid
5-guanidino-2-Oxopentanoate
5-guanidino-2-Oxopentanoic acid
5-guanidino-2-Oxovaleric acid
5-guanidino-2-oxo-Pentanoate
5-guanidino-2-oxo-Pentanoic acid
D-guanidino-a-Oxovaleric acid
D-guanido-a-Ketovaleric acid
a-keto-D-Guanidinovaleric acid
a-keto-delta-Guanidinopentanoate
a-keto-delta-Guanidinopentanoic acid
a-keto-delta-Guanidinovalerate
a-keto-delta-Guanidinovaleric acid
a-keto-delta-guanidinopentanoate
a-keto-delta-guanidinopentanoic acid
a-keto-delta-guanidinovalerate
a-keto-delta-guanidinovaleric acid
alpha-keto-delta-Guanidinopentanoate
alpha-keto-delta-Guanidinopentanoic acid
alpha-keto-delta-Guanidinovalerate
alpha-keto-delta-guanidinopentanoate
alpha-keto-delta-guanidinopentanoic acid
alpha-keto-delta-guanidinovalerate
alpha-keto-delta-guanidinovaleric acid
delta-guanidino-alpha-Oxovaleric acid
delta-guanido-alpha-Ketovaleric acid
seedM:cpd02364 2-Oxo-5-guanidinopentanoate
2-Oxo-5-guanidino-pentanoate
2-Oxoarginine
2-keto-5-guanidinovalerate
2-ketoarginine
2-oxo-5-guanidino-pentanoate
2-oxo-5-guanidinopentanoate
2-oxoarginine
5-Guanidino-2-oxo-pentanoate
5-Guanidino-2-oxopentanoate
5-carbamimidamido-2-oxopentanoate
5-guanidino-2-oxo-pentanoate
5-guanidino-2-oxopentanoate
alpha-ketoarginine
chebi:18253 5-guanidino-2-oxopentanoate
2-oxo-5-guanidino-pentanoate
2-oxo-5-guanidinopentanoate
5-carbamimidamido-2-oxopentanoate
biggM:M_5g2oxpt
chebi:12129
chebi:1249
chebi:19740
chebi:20572
chebi:2060
hmdb:HMDB0006815
hmdb:HMDB04225
hmdb:HMDB06815
keggC:M_C03771
seedM:M_cpd02364
seedM:M_cpd03528
secondary/obsolete/fantasy identifier
chebi:28116 5-guanidino-2-oxopentanoic acid
2-Oxo-5-guanidino-pentanoate
2-Oxo-5-guanidinopentanoate
2-Oxoarginine
2-oxo-5-guanidinovaleric acid
5-((aminoiminomethyl)amino)-2-oxopentanoic acid
5-Guanidino-2-oxo-pentanoate
5-Guanidino-2-oxopentanoate
5-carbamimidamido-2-oxopentanoic acid
alpha-keto-delta-guanidinopentanoic acid
alpha-keto-delta-guanidinovaleric acid
biggM:5g2oxpt 2-Oxoarginine
MNXM14333is deprecated and replaced by this entry