Feedback

decanoate

PropertiesImageOccurences in reactions
MNX_IDMNXM1043Image of MNXM1043
#reac
in my sandbox 0
in MNXref (generic)48
in models (compartimentalized) 31
formulaC10H19O2
charge-1
mass171.13905
referencechebi:27689
InChIKeyGHVNFZFCNZKVNT-UHFFFAOYSA-M
InChIInChI=1S/C10H20O2/c1-2-3-4-5-6-7-8-9-10(11)12/h2-9H2,1H3,(H,11,12)/p-1
SMILESCCCCCCCCCC(=O)[O-]
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:27689
chebi:27689
decanoate
1-nonanecarboxylate
CH3-[CH2]8-COO(-)
caprate
caprinate
caprynate
decanoic acid anion
decoate
decylate
n-caprate
n-decanoate
n-decoate
n-decylate
nC9H19CO2 anion
hmdb:HMDB0000511 Capric acid
1-Nonanecarboxylate
1-Nonanecarboxylic acid
10:0
C10:0
CH3-[CH2]8-COOH
Caprate
Caprinate
Caprinic acid
Caprynate
Caprynic acid
Decanoate
Decanoic acid
Decanoic acid, sodium salt
Decoate
Decoic acid
Decylate
Decylic acid
Dekansaeure
Emery 659
FA(10:0)
Kaprinsaeure
Lunac 10-95
Lunac 10-98
N-Caprate
N-Capric acid
N-Decanoate
N-Decanoic acid
N-Decoate
N-Decoic acid
N-Decylate
N-Decylic acid
Prifac 2906
Prifac 296
Sodium caprate
Sodium decanoate
capric acid
decanoic acid
lipidmaps:LMFA01010010
lipidmapsM:LMFA01010010
Capric acid
C10:0
Caprinic acid
Decanoic acid
Decoic acid
Decylic acid
FA 10:0
bigg.metabolite:dca
biggM:dca
Decanoate (n-C10:0)
seed.compound:cpd01107
seedM:cpd01107
Decanoate
Decanoate (n-C10:0)
Decanoic acid
Decylic acid
caprate
caprinate
caprinic acid
dca
decanoate
decanoic acid
n-Capric acid
n-capric acid
n-decanoate
sabiork.compound:2296
sabiorkM:2296
Decanoate
Decanoic acid
Decylic acid
n-Capric acid
kegg.compound:C01571
keggC:C01571
Decanoic acid
Decanoate
Decylic acid
n-Capric acid
SLM:000000855
slm:000000855
decanoate
Caprate
metacyc.compound:CPD-3617
metacycM:CPD-3617
decanoate
caprate
capric acid
caprinate
caprinic acid
decanoic acid
n-capric acid
n-decanoate
reactome:R-ALL-422019
reactomeM:R-ALL-422019
reactome:R-ALL-879581
reactomeM:R-ALL-879581
reactome:R-ALL-879620
reactomeM:R-ALL-879620
CHEBI:30813
chebi:30813
decanoic acid
1-nonanecarboxylic acid
10:0
C10:0
CH3-[CH2]8-COOH
DECANOIC ACID
Decanoate
Decanoic acid
Decylic acid
Dekansaeure
Kaprinsaeure
capric acid
caprinic acid
decoic acid
n-Capric acid
n-decanoic acid
n-decoic acid
n-decylic acid
hmdb:HMDB00511
chebi:125804
chebi:23570
chebi:23572
chebi:41906
chebi:4347
biggM:M_dca
keggC:M_C01571
seedM:M_cpd01107
secondary/obsolete/fantasy identifier