Feedback

decanoate

Properties
MNX_IDMNXM1043
formulaC10H19O2
charge-1
mass171.25666
referencechebi:27689
Image of MNXM1043
InChIKeyGHVNFZFCNZKVNT-UHFFFAOYSA-M
InChIInChI=1S/C10H20O2/c1-2-3-4-5-6-7-8-9-10(11)12/h2-9H2,1H3,(H,11,12)/p-1
SMILESCCCCCCCCCC([O-])=O

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref45
Distinct compatimentalized reactions in models22

Similar chemical compounds in external resources
IdentifierDescription
sabiorkM:2296 Decanoate
Decanoic acid
Decylic acid
n-Capric acid
lipidmaps:LMFA01010010 Capric acid
C10:0
Caprinic acid
Decanoic acid
Decoic acid
Decylic acid
FA(10:0)
seedM:cpd01107 Decanoate
Decanoate (n-C10:0)
Decanoic acid
Decylic acid
caprate
caprinate
caprinic acid
dca
decanoate
decanoic acid
n-Capric acid
n-capric acid
n-decanoate
chebi:27689 decanoate
1-nonanecarboxylate
CH3-[CH2]8-COO(-)
caprate
caprinate
caprynate
decanoic acid anion
decoate
decylate
n-caprate
n-decanoate
n-decoate
n-decylate
nC9H19CO2 anion
slm:000000855 decanoate
Caprate
biggM:dca Decanoate (n-C10:0)
keggC:C01571 Decanoic acid
Decanoate
Decylic acid
n-Capric acid
chebi:30813
reactome:R-ALL-422019
reactome:R-ALL-879581
reactome:R-ALL-879620
decanoic acid
1-nonanecarboxylic acid
10:0
C10:0
CH3-[CH2]8-COOH
DECANOIC ACID
Decanoate
Decanoic acid
Decylic acid
Dekansaeure
Kaprinsaeure
capric acid
caprinic acid
decoic acid
n-Capric acid
n-decanoic acid
n-decoic acid
n-decylic acid
hmdb:HMDB0000511 Capric acid
1-Nonanecarboxylate
1-Nonanecarboxylic acid
10:0
C10:0
CH3-[CH2]8-COOH
Caprate
Caprinate
Caprinic acid
Caprynate
Caprynic acid
Decanoate
Decanoic acid
Decanoic acid, sodium salt
Decoate
Decoic acid
Decylate
Decylic acid
Dekansaeure
Emery 659
FA(10:0)
Kaprinsaeure
Lunac 10-95
Lunac 10-98
N-Caprate
N-Capric acid
N-Decanoate
N-Decanoic acid
N-Decoate
N-Decoic acid
N-Decylate
N-Decylic acid
Prifac 2906
Prifac 296
Sodium caprate
Sodium decanoate
capric acid
decanoic acid
metacycM:CPD-3617 decanoate
caprate
caprinate
caprinic acid
decanoic acid
n-capric acid
n-decanoate
biggM:M_dca
chebi:125804
chebi:23570
chebi:23572
chebi:41906
chebi:4347
hmdb:HMDB00511
keggC:M_C01571
seedM:M_cpd01107
secondary/obsolete/fantasy identifier
MNXM162295is deprecated and replaced by this entry