Feedback

1,5-anhydro-D-fructose

PropertiesImageOccurences in reactions
MNX_IDMNXM1060Image of MNXM1060
#reac
in my sandbox 0
in MNXref (generic)24
in models (compartimentalized) 0
formulaC6H10O5
charge0
mass162.1406
referencechebi:16715
InChIKeyOCLOLUFOLJIQDC-HSUXUTPPSA-N
InChIInChI=1S/C6H10O5/c7-1-4-6(10)5(9)3(8)2-11-4/h4-7,9-10H,1-2H2/t4-,5-,6-/m1/s1
SMILESOC[C@H]1OCC(=O)[C@@H](O)[C@@H]1O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:16715
chebi:16715
1,5-anhydro-D-fructose
1,5-Anhydro-D-fructose
1,5-anhydro-D-threo-hex-2-ulose
sabiork.compound:1624
sabiorkM:1624
envipath:...eb9b56c0e0a7
envipathM:...eb9b56c0e0a7
kegg.compound:C06485
keggC:C06485
1,5-Anhydro-D-fructose
seed.compound:cpd03896
seedM:cpd03896
1,5-Anhydro-D-fructose
(4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)dihydro-2H-pyran-3(4H)-one
(4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-one
1,5-anhydro-D-arabino-hex-2-ulose
1,5-anhydro-D-fructose
metacyc.compound:15-ANHYDRO-D-FRUCTOSE
metacycM:15-ANHYDRO-D-FRUCTOSE
1,5-anhydro-D-fructose
(4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)dihydro-2H-pyran-3(4H)-one
(4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-one
1,5-anhydro-D-arabino-hex-2-ulose
chebi:11175
chebi:18942
chebi:549
keggC:M_C06485
seedM:M_cpd03896
secondary/obsolete/fantasy identifier