|
![]() |
InChIKey | PGSWEKYNAOWQDF-UHFFFAOYSA-N |
InChI | InChI=1S/C7H8O2/c1-5-3-2-4-6(8)7(5)9/h2-4,8-9H,1H3 |
SMILES | Cc1cccc(O)c1O |
#reac | |
---|---|
Distinct reactions in my sandbox | 0 |
Distinct generic reactions in MNXref | 16 |
Distinct compatimentalized reactions in models | 3 |
Identifier | Description |
---|---|
keggC:C02923 sabiorkM:2587 | 2,3-Dihydroxytoluene 3-Methylcatechol |
chebi:18404 | 3-methylcatechol 2,3-Dihydroxytoluene 2,3-dihydroxytoluene 3-METHYLCATECHOL 3-Methylcatechol 3-methylbenzene-1,2-diol |
envipath:...d01703279465 envipath:...85588caf482a envipath:...b9533813b5e8 envipath:...4b790fb57594 | compound 44250 |
seedM:cpd01871 | 3-Methylcatechol 2,3-Dihydroxytoluene 2,3-dihydroxytoluene 3-methylcatechol 3mcat |
metacycM:CPD-111 | 3-methylcatechol 2,3-dihydroxytoluene |
biggM:M_3mcat chebi:11857 chebi:20127 chebi:43829 chebi:887 keggC:M_C02923 seedM:M_cpd01871 | secondary/obsolete/fantasy identifier |
envipath:...65d095831986 | compound 44251 |
biggM:3mcat envipath:...555064a8f8f4 | 3-Methylcatechol |
MNXM724362 | is deprecated and replaced by this entry |
MNXM724363 | is deprecated and replaced by this entry |