Feedback

hexadecanoate

PropertiesImageOccurences in reactions
MNX_IDMNXM108Image of MNXM108
#reac
in my sandbox 0
in MNXref (generic)320
in models (compartimentalized) 150
formulaC16H31O2
charge-1
mass255.41614
referencechebi:7896
InChIKeyIPCSVZSSVZVIGE-UHFFFAOYSA-M
InChIInChI=1S/C16H32O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18/h2-15H2,1H3,(H,17,18)/p-1
SMILESCCCCCCCCCCCCCCCC([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:7896
chebi:7896
hexadecanoate
(16:0)
1-hexyldecanoate
1-pentadecanecarboxylate
CH3-[CH2]14-COO(-)
Hexadecanoic acid, ion(1-)
n-hexadecanoate
n-hexadecoate
palmitate
pentadecanecarboxylate
envipath:...f7d8bf32b1cb
envipathM:...f7d8bf32b1cb
Hexadecanoate
bigg.metabolite:hdca
biggM:hdca
Hexadecanoate (n-C16:0)
kegg.compound:C00249
keggC:C00249
Hexadecanoic acid
Cetylic acid
Hexadecanoate
Hexadecylic acid
Palmitate
Palmitic acid
seed.compound:cpd00214
seedM:cpd00214
Palmitate
Cetylic acid
Hexadecanoate
Hexadecanoate (n-C16:0)
Hexadecanoic acid
Hexadecylic acid
Palmitic acid
Palmitic_acid
hdca
hexadecanoate
hexadecanoate (n-C16:0)
hexadecanoic acid
palmitate
palmitic acid
sabiork.compound:1990
sabiorkM:1990
Palmitate
Cetylic acid
Hexadecanoate
Hexadecanoic acid
Hexadecylic acid
Palmitic acid
kegg.drug:D05341
keggD:D05341
Palmitic acid (NF)
hmdb:HMDB0000220 Palmitic acid
1-Hexyldecanoate
1-Hexyldecanoic acid
1-Pentadecanecarboxylate
1-Pentadecanecarboxylic acid
16:00
Acid, hexadecanoic
Acid, palmitic
C16
C16 Fatty acid
C16:0
CH3-[CH2]14-COOH
Cetylate
Cetylic acid
Edenor C16
Emersol 140
Emersol 143
FA(16:0)
Glycon P-45
Hexadecanoate
Hexadecanoate (N-C16:0)
Hexadecanoic acid
Hexadecanoic acid palmitic acid
Hexadecoate
Hexadecoic acid
Hexadecylate
Hexadecylic acid
Hexaectylate
Hexaectylic acid
Hydrofol
Hydrofol acid 1690
Hystrene 8016
Hystrene 9016
Industrene 4516
Kortacid 1698
Loxiol ep 278
Lunac P 95
Lunac P 95KC
Lunac P 98
N-Hexadecanoate
N-Hexadecanoic acid
N-Hexadecoate
N-Hexadecoic acid
PAM
PLM
Palmitate
Palmitinate
Palmitinic acid
Palmitinsaeure
Palmitoate
Palmitoic acid
Pentadecanecarboxylate
Pentadecanecarboxylic acid
Prifac 2960
Prifrac 2960
Pristerene 4934
Univol u332
hexadecanoic acid
palmitic acid
lipidmaps:LMFA01010001
lipidmapsM:LMFA01010001
Palmitic acid
Aethalic acid
C16:0
Cetylic acid
FA(16:0)
Palmitate
hexadecanoic acid
n-Hexadecanoic acid
SLM:000000510
slm:000000510
hexadecanoate
Palmitate
reactome:R-ALL-2453691
reactomeM:R-ALL-2453691
reactome:R-ALL-3632881
reactomeM:R-ALL-3632881
reactome:R-ALL-390435
reactomeM:R-ALL-390435
reactome:R-ALL-400150
reactomeM:R-ALL-400150
reactome:R-ALL-400452
reactomeM:R-ALL-400452
reactome:R-ALL-426576
reactomeM:R-ALL-426576
reactome:R-ALL-76168
reactomeM:R-ALL-76168
CHEBI:15756
chebi:15756
hexadecanoic acid
1-Pentadecanecarboxylic acid
1-hexyldecanoic acid
16:00
C16
C16 fatty acid
C16:0
CH3-[CH2]14-COOH
FA 16:0
Hexadecanoate
Hexadecylic acid
Hexaectylic acid
PALMITIC ACID
Palmitate
Palmitic acid
Palmitinic acid
Palmitinsaeure
Pentadecanecarboxylic acid
cetylic acid
hexadecoic acid
n-hexadecanoic acid
n-hexadecoic acid
palmitic acid
metacyc.compound:PALMITATE
metacycM:PALMITATE
palmitate
hexadecanoate
hexadecanoate (n-C16:0)
hexadecanoic acid
palmitic acid
hmdb:HMDB00220
hmdb:HMDB0060083
hmdb:HMDB60083
chebi:14730
chebi:231736
chebi:233028
chebi:24540
chebi:24541
chebi:24542
chebi:24550
chebi:29889
chebi:35978
chebi:44952
biggM:M_hdca
keggC:M_C00249
keggD:M_D05341
seedM:M_cpd00214
secondary/obsolete/fantasy identifier