Feedback

N-carbamoyl-2-oxoglycine

PropertiesImageOccurences in reactions
MNX_IDMNXM1088Image of MNXM1088
#reac
in my sandbox 0
in MNXref (generic)8
in models (compartimentalized) 3
formulaC3H3N2O4
charge-1
mass131.067
referencechebi:57824
InChIKeyUWBHMRBRLOJJAA-UHFFFAOYSA-M
InChIInChI=1S/C3H4N2O4/c4-3(9)5-1(6)2(7)8/h(H,7,8)(H3,4,5,6,9)/p-1
SMILESNC(=O)NC(=O)C([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:57824
chebi:57824
N-carbamoyl-2-oxoglycine
(carbamoylamino)(oxo)acetate
2-(carbamoylamino)-2-oxoacetate
oxalurate
oxalurate anion
oxalurate(1-)
metacyc.compound:CPD-389
metacycM:CPD-389
N-carbamoyl-2-oxoglycine
2-(carbamoylamino)-2-oxoacetate
N-carbamoyloxamate
carbamyl oxamate
monooxalylurea
oxalurate
oxalureate
oxaluric acid
ureido(oxo)acetic acid
seed.compound:cpd00596
seedM:cpd00596
Oxalurate
2-(carbamoylamino)-2-oxoacetate
Monooxalylurea
N-carbamoyl-2-oxoglycine
N-carbamoyloxamate
Oxalureate
Oxaluric acid
carbamyl oxamate
monooxalylurea
oxalurate
oxalureate
oxaluric acid
oxur
ureido(oxo)acetic acid
bigg.metabolite:oxur
biggM:oxur
Oxalureate
sabiork.compound:1877
sabiorkM:1877
Oxalureate
2-(Carbamoylamino)-2-oxoacetic acid
Monooxalylurea
Oxalurate
Oxaluric acid
kegg.compound:C00802
keggC:C00802
Oxalureate
Monooxalylurea
N-Carbamoyl-2-oxoglycine
Oxalurate
Oxaluric acid
CHEBI:16582
chebi:16582
oxaluric acid
(carbamoylamino)(oxo)acetic acid
Monooxalylurea
Oxalurate
Oxalureate
Oxaluric acid
onooxalylurea
oxal
ureido(oxo)acetic acid
chebi:14706
chebi:25736
chebi:25737
chebi:7816
biggM:M_oxur
keggC:M_C00802
seedM:M_cpd00596
secondary/obsolete/fantasy identifier