Feedback

N-carbamoyl-2-oxoglycine

Properties
MNX_IDMNXM1088
formulaC3H3N2O4
charge-1
mass131.067
referencechebi:57824
Image of MNXM1088
InChIKeyUWBHMRBRLOJJAA-UHFFFAOYSA-M
InChIInChI=1S/C3H4N2O4/c4-3(9)5-1(6)2(7)8/h(H,7,8)(H3,4,5,6,9)/p-1
SMILESNC(=O)NC(=O)C([O-])=O

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref8
Distinct compatimentalized reactions in models3

Similar chemical compounds in external resources
IdentifierDescription
sabiorkM:1877 Oxalureate
2-(Carbamoylamino)-2-oxoacetic acid
Monooxalylurea
Oxalurate
Oxaluric acid
chebi:16582 oxaluric acid
(carbamoylamino)(oxo)acetic acid
Monooxalylurea
Oxalurate
Oxalureate
Oxaluric acid
onooxalylurea
oxal
ureido(oxo)acetic acid
seedM:cpd00596 Oxalurate
2-(carbamoylamino)-2-oxoacetate
Monooxalylurea
N-carbamoyl-2-oxoglycine
N-carbamoyloxamate
Oxalureate
Oxaluric acid
carbamyl oxamate
monooxalylurea
oxalurate
oxalureate
oxaluric acid
oxur
ureido(oxo)acetic acid
chebi:57824 N-carbamoyl-2-oxoglycine
(carbamoylamino)(oxo)acetate
2-(carbamoylamino)-2-oxoacetate
oxalurate
oxalurate anion
oxalurate(1-)
biggM:M_oxur
chebi:14706
chebi:25736
chebi:25737
chebi:7816
keggC:M_C00802
seedM:M_cpd00596
secondary/obsolete/fantasy identifier
keggC:C00802 Oxalureate
Monooxalylurea
N-Carbamoyl-2-oxoglycine
Oxalurate
Oxaluric acid
metacycM:CPD-389 N-carbamoyl-2-oxoglycine
2-(carbamoylamino)-2-oxoacetate
N-carbamoyloxamate
carbamyl oxamate
monooxalylurea
oxalurate
oxalureate
oxaluric acid
ureido(oxo)acetic acid
biggM:oxur Oxalureate