This is version 4.2 of MetaNetX/MNXref
 Feedback

diphosphate

PropertiesImageOccurences in reactions
MNX_IDMNXM11Image of MNXM11
#reac
in my sandbox 0
in MNXref (generic)3297
in models (compartimentalized) 1193
formulaHO7P2
charge-3
mass174.951262
referencechebi:33019
InChIKeyXPPKVPWEQAFLFU-UHFFFAOYSA-K
InChIInChI=1S/H4O7P2/c1-8(2,3)7-9(4,5)6/h(H2,1,2,3)(H2,4,5,6)/p-3
SMILESOP([O-])(=O)OP([O-])([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:33019
chebi:33019
diphosphate
HP2O7(3-)
diphosphate(3-)
hydrogen diphosphate
bigg.metabolite:ppi
biggM:ppi
Diphosphate
kegg.compound:C00013
keggC:C00013
Diphosphate
Diphosphoric acid
PPi
Pyrophosphate
Pyrophosphoric acid
sabiork.compound:1267
sabiorkM:1267
Diphosphate
PPi
Pyrophosphate
Pyrophosphoric acid
seed.compound:cpd00012
seedM:cpd00012
PPi
Diphosphate
Diphosphoric acid
PP
Pyrophosphate
Pyrophosphoric acid
diphosphate
ppi
pyrophosphate
hmdb:HMDB0000250 Pyrophosphate
(phosphonooxy)phosphonic acid
Acide diphosphorique
Diphosphoric acid
Diphosphorsaeure
H4P2O7
PYROphosphATE
Pyrophosphoric acid
Pyrophosphorsaeure
[(ho)2P(O)OP(O)(OH)2]
pyrophosphoric acid
metacyc.compound:PYROPHOSPHATE-GROUP
metacycM:PYROPHOSPHATE-GROUP
a pyrophosphate group
CHEBI:33017
chebi:33017
diphosphate(1-)
H3P2O7(-)
trihydrogen diphosphate
CHEBI:45212
chebi:45212
diphosphate(2-)
H2P2O7(2-)
PYROPHOSPHATE 2-
dihydrogen diphosphate
CHEBI:18361
chebi:18361
diphosphate(4-)
DIPHOSPHATE
Diphosphat
Diphosphate
P2O7(4-)
PPi
Pyrophosphat
Pyrophosphate
[O3POPO3](4-)
diphosphate
mu-oxido-bis(trioxidophosphate)(4-)
mu-oxo-hexaoxodiphosphate
pyrophosphate ion
metacyc.compound:PPI
metacycM:PPI
diphosphate
PP
PPi
pyrophosphate
reactome:R-ALL-111294
reactomeM:R-ALL-111294
reactome:R-ALL-113541
reactomeM:R-ALL-113541
reactome:R-ALL-113542
reactomeM:R-ALL-113542
reactome:R-ALL-114654
reactomeM:R-ALL-114654
reactome:R-ALL-159450
reactomeM:R-ALL-159450
reactome:R-ALL-2046049
reactomeM:R-ALL-2046049
reactome:R-ALL-389593
reactomeM:R-ALL-389593
CHEBI:29888
chebi:29888
diphosphoric acid
1,5-dihydrido-2,4-dihydroxido-2,4-dioxido-1,3,5-trioxy-2,4-diphosphy-[5]catena
Diphosphoric acid
Diphosphorsaeure
H4P2O7
PYROPHOSPHATE
Pyrophosphate
Pyrophosphoric acid
Pyrophosphorsaeure
[(HO)2P(O)OP(O)(OH)2]
acide diphosphorique
mu-oxido-bis(dihydroxidooxidophosphorus)
seed.compound:cpd27828
seedM:cpd27828
pyrophosphate-group
a pyrophosphate group
hmdb:HMDB00250
chebi:13420
chebi:33018
chebi:42009
chebi:45067
chebi:45208
chebi:8683
biggM:M_ppi
keggC:M_C00013
seedM:M_cpd00012
seedM:M_cpd27828
secondary/obsolete/fantasy identifier