Feedback

(6R)-5,10-methylene-5,6,7,8-tetrahydrofolate

PropertiesImageOccurences in reactions
MNX_IDMNXM1102150Image of MNXM1102150
#reac
in my sandbox 0
in MNXref (generic)75
in models (compartimentalized) 71
formulaC20H21N7O6
charge-2
mass455.15643
referencechebi:15636
InChIKeyQYNUQALWYRSVHF-OLZOCXBDSA-L
InChIInChI=1S/C20H23N7O6/c21-20-24-16-15(18(31)25-20)27-9-26(8-12(27)7-22-16)11-3-1-10(2-4-11)17(30)23-13(19(32)33)5-6-14(28)29/h1-4,12-13H,5-9H2,(H,23,30)(H,28,29)(H,32,33)(H4,21,22,24,25,31)/p-2/t12-,13+/m1/s1
SMILESNc1nc2c(c(=O)[nH]1)N1CN(c3ccc(C(=O)N[C@@H](CCC(=O)[O-])C(=O)[O-])cc3)C[C@H]1CN2
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:15636
chebi:15636
(6R)-5,10-methylene-5,6,7,8-tetrahydrofolate
(6R)-5,10-CH2-H4folate
(6R)-5,10-methylenetetrahydrofolate(2-)
N-(5,10-methylene-5,6,7,8-tetrahydropteroyl)-L-glutamate
N-{4-[(6aR)-3-amino-1-oxo-1,2,5,6,6a,7-hexahydroimidazo[1,5-f]pteridin-8(9H)-yl]benzoyl}-L-glutamate
CHEBI:1989
chebi:1989
(6R)-5,10-methylenetetrahydrofolic acid
(6R)-5,10-Methylenetetrahydrofolate
5,10-Methylene-THF
5,10-Methylenetetrahydrofolate
5,10-methylenetetrahydrofolic acid
N-{4-[(6aR)-3-amino-1-oxo-1,2,5,6,6a,7-hexahydroimidazo[1,5-f]pteridin-8(9H)-yl]benzoyl}-L-glutamic acid
hmdb:HMDB0001533 5,10-Methylene-THF
(6R)-5,10-Methylenetetrahydrofolate
(6R)-5,10-Methylenetetrahydrofolic acid
2-({4-[(6aR)-3-amino-1-oxo-1H,2H,5H,6H,6aH,7H,8H,9H-imidazolidino[1,5-f]pteridin-8-yl]phenyl}formamido)pentanedioic acid
2-({4-[(6aR)-3-amino-1-oxo-2H,5H,6H,6aH,7H,9H-imidazolidino[1,5-f]pteridin-8-yl]phenyl}formamido)pentanedioic acid
5,10-Methenyltetrahydropteroylglutamate
5,10-Methylene-5,6,7,8-tetrahydrofolate
5,10-Methylene-6-hydrofolate
5,10-Methylene-6-hydrofolic acid
5,10-Methylenetetrahydrofolate
5,10-Methylenetetrahydrofolate monohydrochloride, (L-glu)-isomer
5,10-Methylenetetrahydrofolate, (D-glu)-isomer
5,10-Methylenetetrahydrofolate, (L-glu)-(S)-isomer
5,10-Methylenetetrahydrofolic acid
CH2H4Folate
N5>,N10-methylenetetrahydrofolate
Tetrahydromethylenefolate
bigg.metabolite:mlthf
biggM:mlthf
5,10-Methylenetetrahydrofolate
sabiork.compound:1308
sabiorkM:1308
5,10-Methylenetetrahydrofolate
(6R)-5,10-Methylenetetrahydrofolate
5,10-Methylene-H4PteGlu1
5,10-Methylene-THF
kegg.compound:C00143
keggC:C00143
5,10-Methylenetetrahydrofolate
(6R)-5,10-Methylenetetrahydrofolate
5,10-Methylene-THF
metacyc.compound:METHYLENE-THF
metacycM:METHYLENE-THF
5,10-methylenetetrahydropteroyl mono-L-glutamate
5,10-methylene-H4PteGlu1
5,10-methylenetetrahydrofolate mono-L-glutamate
N5,N10-methylenetetrahydrofolate mono-L-glutamate
seed.compound:cpd00125
seedM:cpd00125
5-10-Methylenetetrahydrofolate
(6R)-5,10-Methylenetetrahydrofolate
5,10-Methylene-THF
5,10-Methylenetetrahydrofolate
5,10-methylene-H4PteGlu1
5,10-methylene-THF
5,10-methylenetetrahydrofolate
5,10-methylenetetrahydrofolate mono-L-glutamate
5,10-methylenetetrahydropteroyl mono-L-glutamate
N5,N10-methylenetetrahydrofolate
N5,N10-methylenetetrahydrofolate mono-L-glutamate
mlthf
kegg.drug:D11447
keggD:D11447
Arfolitixorin (USAN/INN)
hmdb:HMDB0002365
hmdb:HMDB01533
hmdb:HMDB02365
chebi:10925
chebi:18602
biggM:M_mlthf
keggC:M_C00143
keggD:M_D11447
seedM:M_cpd00125
secondary/obsolete/fantasy identifier